C22H26F3N3O2 — CID 118347304
2-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)-(2,2,2-trifluoroethyl)amino]pyrimidine-5-carboxylic acid (PubChem CID 118347304) has the molecular formula C22H26F3N3O2 and a molecular weight of 421.46 g/mol. Its IUPAC name is 2-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)-(2,2,2-trifluoroethyl)amino]pyrimidine-5-carboxylic acid.
| Compound Name | 2-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)-(2,2,2-trifluoroethyl)amino]pyrimidine-5-carboxylic acid |
|---|---|
| PubChem CID | 118347304 |
| Molecular Formula | C22H26F3N3O2 |
| Molecular Weight | 421.46 g/mol |
| Exact Mass | 421.20 |
| IUPAC Name | 2-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)-(2,2,2-trifluoroethyl)amino]pyrimidine-5-carboxylic acid |
| SMILES | Cc1cc2c(cc1N(CC(F)(F)F)c1ncc(C(=O)O)cn1)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C22H26F3N3O2/c1-13-8-15-16(21(4,5)7-6-20(15,2)3)9-17(13)28(12-22(23,24)25)19-26-10-14(11-27-19)18(29)30/h8-11H,6-7,12H2,1-5H3,(H,29,30) |
| InChIKey | HKLFCDIPKYGZJU-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 66.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.46 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |