C21H24F3N3O2 — CID 118347308
2-[(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-(2,2,2-trifluoroethyl)amino]pyrimidine-5-carboxylic acid (PubChem CID 118347308) has the molecular formula C21H24F3N3O2 and a molecular weight of 407.44 g/mol. Its IUPAC name is 2-[(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-(2,2,2-trifluoroethyl)amino]pyrimidine-5-carboxylic acid.
| Compound Name | 2-[(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-(2,2,2-trifluoroethyl)amino]pyrimidine-5-carboxylic acid |
|---|---|
| PubChem CID | 118347308 |
| Molecular Formula | C21H24F3N3O2 |
| Molecular Weight | 407.44 g/mol |
| Exact Mass | 407.18 |
| IUPAC Name | 2-[(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-(2,2,2-trifluoroethyl)amino]pyrimidine-5-carboxylic acid |
| SMILES | CC1(C)CCC(C)(C)c2cc(N(CC(F)(F)F)c3ncc(C(=O)O)cn3)ccc21 |
| InChI | InChI=1S/C21H24F3N3O2/c1-19(2)7-8-20(3,4)16-9-14(5-6-15(16)19)27(12-21(22,23)24)18-25-10-13(11-26-18)17(28)29/h5-6,9-11H,7-8,12H2,1-4H3,(H,28,29) |
| InChIKey | OKWMAYPVLWTRIH-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 66.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.44 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |