About 1-[2-[(4,4-dimethyl-9,10-dihydro-1H-anthracen-2-yl)oxy]ethyl]-4-methylsulfonylpiperazine
1-[2-[(4,4-dimethyl-9,10-dihydro-1H-anthracen-2-yl)oxy]ethyl]-4-methylsulfonylpiperazine (PubChem CID 118347708) has the molecular formula C23H32N2O3S
and a molecular weight of 416.59 g/mol. Its IUPAC name is 1-[2-[(4,4-dimethyl-9,10-dihydro-1H-anthracen-2-yl)oxy]ethyl]-4-methylsulfonylpiperazine.
Molecular Properties
| Compound Name | 1-[2-[(4,4-dimethyl-9,10-dihydro-1H-anthracen-2-yl)oxy]ethyl]-4-methylsulfonylpiperazine |
| PubChem CID | 118347708 |
| Molecular Formula | C23H32N2O3S |
| Molecular Weight | 416.59 g/mol |
| Exact Mass | 416.21 |
| IUPAC Name | 1-[2-[(4,4-dimethyl-9,10-dihydro-1H-anthracen-2-yl)oxy]ethyl]-4-methylsulfonylpiperazine |
| SMILES | CC1(C)C=C(OCCN2CCN(S(C)(=O)=O)CC2)CC2=C1Cc1ccccc1C2 |
| InChI | InChI=1S/C23H32N2O3S/c1-23(2)17-21(15-20-14-18-6-4-5-7-19(18)16-22(20)23)28-13-12-24-8-10-25(11-9-24)29(3,26)27/h4-7,17H,8-16H2,1-3H3 |
| InChIKey | YVJGDPGRQCYEQS-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 416.59 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-[2-[(4,4-dimethyl-9,10-dihydro-1H-anthracen-2-yl)oxy]ethyl]-4-methylsulfonylpiperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-[(4,4-dimethyl-9,10-dihydro-1H-anthracen-2-yl)oxy]ethyl]-4-methylsulfonylpiperazine?
The IUPAC name of 1-[2-[(4,4-dimethyl-9,10-dihydro-1H-anthracen-2-yl)oxy]ethyl]-4-methylsulfonylpiperazine (CID 118347708) is 1-[2-[(4,4-dimethyl-9,10-dihydro-1H-anthracen-2-yl)oxy]ethyl]-4-methylsulfonylpiperazine.
What is the SMILES notation for 1-[2-[(4,4-dimethyl-9,10-dihydro-1H-anthracen-2-yl)oxy]ethyl]-4-methylsulfonylpiperazine?
The canonical SMILES for 1-[2-[(4,4-dimethyl-9,10-dihydro-1H-anthracen-2-yl)oxy]ethyl]-4-methylsulfonylpiperazine is CC1(C)C=C(OCCN2CCN(S(C)(=O)=O)CC2)CC2=C1Cc1ccccc1C2.
What is the InChIKey of 1-[2-[(4,4-dimethyl-9,10-dihydro-1H-anthracen-2-yl)oxy]ethyl]-4-methylsulfonylpiperazine?
The InChIKey is YVJGDPGRQCYEQS-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H32N2O3S/c1-23(2)17-21(15-20-14-18-6-4-5-7-19(18)16-22(20)23)28-13-12-24-8-10-25(11-9-24)29(3,26)27/h4-7,17H,8-16H2,1-3H3.
What are the key properties of 1-[2-[(4,4-dimethyl-9,10-dihydro-1H-anthracen-2-yl)oxy]ethyl]-4-methylsulfonylpiperazine?
1-[2-[(4,4-dimethyl-9,10-dihydro-1H-anthracen-2-yl)oxy]ethyl]-4-methylsulfonylpiperazine has a molecular weight of 416.59 g/mol, XLogP of 2.99, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-[(4,4-dimethyl-9,10-dihydro-1H-anthracen-2-yl)oxy]ethyl]-4-methylsulfonylpiperazine is sourced from PubChem (CID 118347708), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).