C23H19F2N5O2 — CID 118347837
2-[4-[[2-(2,6-difluorophenyl)-5-oxo-6,7-dihydropyrrolo[3,4-d]pyrimidin-4-yl]amino]phenyl]-N-ethylprop-2-enamide (PubChem CID 118347837) has the molecular formula C23H19F2N5O2 and a molecular weight of 435.43 g/mol. Its IUPAC name is 2-[4-[[2-(2,6-difluorophenyl)-5-oxo-6,7-dihydropyrrolo[3,4-d]pyrimidin-4-yl]amino]phenyl]-N-ethylprop-2-enamide.
| Compound Name | 2-[4-[[2-(2,6-difluorophenyl)-5-oxo-6,7-dihydropyrrolo[3,4-d]pyrimidin-4-yl]amino]phenyl]-N-ethylprop-2-enamide |
|---|---|
| PubChem CID | 118347837 |
| Molecular Formula | C23H19F2N5O2 |
| Molecular Weight | 435.43 g/mol |
| Exact Mass | 435.15 |
| IUPAC Name | 2-[4-[[2-(2,6-difluorophenyl)-5-oxo-6,7-dihydropyrrolo[3,4-d]pyrimidin-4-yl]amino]phenyl]-N-ethylprop-2-enamide |
| SMILES | C=C(C(=O)NCC)c1ccc(Nc2nc(-c3c(F)cccc3F)nc3c2C(=O)NC3)cc1 |
| InChI | InChI=1S/C23H19F2N5O2/c1-3-26-22(31)12(2)13-7-9-14(10-8-13)28-21-19-17(11-27-23(19)32)29-20(30-21)18-15(24)5-4-6-16(18)25/h4-10H,2-3,11H2,1H3,(H,26,31)(H,27,32)(H,28,29,30) |
| InChIKey | FYWQQYLUSGKYGE-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 96.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.43 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|