About 3-chloro-6-ethoxy-5,6-dihydrobenzo[b][1]benzothiepine
3-chloro-6-ethoxy-5,6-dihydrobenzo[b][1]benzothiepine (PubChem CID 11834788) has the molecular formula C16H15ClOS
and a molecular weight of 290.81 g/mol. Its IUPAC name is 3-chloro-6-ethoxy-5,6-dihydrobenzo[b][1]benzothiepine.
Molecular Properties
| Compound Name | 3-chloro-6-ethoxy-5,6-dihydrobenzo[b][1]benzothiepine |
| PubChem CID | 11834788 |
| Molecular Formula | C16H15ClOS |
| Molecular Weight | 290.81 g/mol |
| Exact Mass | 290.05 |
| IUPAC Name | 3-chloro-6-ethoxy-5,6-dihydrobenzo[b][1]benzothiepine |
| SMILES | CCOC1Cc2cc(Cl)ccc2Sc2ccccc21 |
| InChI | InChI=1S/C16H15ClOS/c1-2-18-14-10-11-9-12(17)7-8-15(11)19-16-6-4-3-5-13(14)16/h3-9,14H,2,10H2,1H3 |
| InChIKey | KEJFVNRAXBWVRH-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 290.81 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-chloro-6-ethoxy-5,6-dihydrobenzo[b][1]benzothiepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-6-ethoxy-5,6-dihydrobenzo[b][1]benzothiepine?
The IUPAC name of 3-chloro-6-ethoxy-5,6-dihydrobenzo[b][1]benzothiepine (CID 11834788) is 3-chloro-6-ethoxy-5,6-dihydrobenzo[b][1]benzothiepine.
What is the SMILES notation for 3-chloro-6-ethoxy-5,6-dihydrobenzo[b][1]benzothiepine?
The canonical SMILES for 3-chloro-6-ethoxy-5,6-dihydrobenzo[b][1]benzothiepine is CCOC1Cc2cc(Cl)ccc2Sc2ccccc21.
What is the InChIKey of 3-chloro-6-ethoxy-5,6-dihydrobenzo[b][1]benzothiepine?
The InChIKey is KEJFVNRAXBWVRH-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15ClOS/c1-2-18-14-10-11-9-12(17)7-8-15(11)19-16-6-4-3-5-13(14)16/h3-9,14H,2,10H2,1H3.
What are the key properties of 3-chloro-6-ethoxy-5,6-dihydrobenzo[b][1]benzothiepine?
3-chloro-6-ethoxy-5,6-dihydrobenzo[b][1]benzothiepine has a molecular weight of 290.81 g/mol, XLogP of 5.12, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-6-ethoxy-5,6-dihydrobenzo[b][1]benzothiepine is sourced from PubChem (CID 11834788), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).