C21H18F2N4O3 — CID 118347885
2-(2,6-difluorophenyl)-4-[4-(2-methoxyethoxy)anilino]-6,7-dihydropyrrolo[3,4-d]pyrimidin-5-one (PubChem CID 118347885) has the molecular formula C21H18F2N4O3 and a molecular weight of 412.40 g/mol. Its IUPAC name is 2-(2,6-difluorophenyl)-4-[4-(2-methoxyethoxy)anilino]-6,7-dihydropyrrolo[3,4-d]pyrimidin-5-one.
| Compound Name | 2-(2,6-difluorophenyl)-4-[4-(2-methoxyethoxy)anilino]-6,7-dihydropyrrolo[3,4-d]pyrimidin-5-one |
|---|---|
| PubChem CID | 118347885 |
| Molecular Formula | C21H18F2N4O3 |
| Molecular Weight | 412.40 g/mol |
| Exact Mass | 412.13 |
| IUPAC Name | 2-(2,6-difluorophenyl)-4-[4-(2-methoxyethoxy)anilino]-6,7-dihydropyrrolo[3,4-d]pyrimidin-5-one |
| SMILES | COCCOc1ccc(Nc2nc(-c3c(F)cccc3F)nc3c2C(=O)NC3)cc1 |
| InChI | InChI=1S/C21H18F2N4O3/c1-29-9-10-30-13-7-5-12(6-8-13)25-20-18-16(11-24-21(18)28)26-19(27-20)17-14(22)3-2-4-15(17)23/h2-8H,9-11H2,1H3,(H,24,28)(H,25,26,27) |
| InChIKey | AGFGHOKCSSXFFX-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 85.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.40 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|