C35H31F2N5O7S — CID 118347992
tert-butyl 5-[4-[[2-(2,6-difluorophenyl)-6-[(2,4-dimethoxyphenyl)methyl]-5-oxo-7H-pyrrolo[3,4-d]pyrimidin-4-yl]amino]phenyl]-2,4-dioxo-1,3-thiazolidine-3-carboxylate (PubChem CID 118347992) has the molecular formula C35H31F2N5O7S and a molecular weight of 703.72 g/mol. Its IUPAC name is tert-butyl 5-[4-[[2-(2,6-difluorophenyl)-6-[(2,4-dimethoxyphenyl)methyl]-5-oxo-7H-pyrrolo[3,4-d]pyrimidin-4-yl]amino]phenyl]-2,4-dioxo-1,3-thiazolidine-3-carboxylate.
| Compound Name | tert-butyl 5-[4-[[2-(2,6-difluorophenyl)-6-[(2,4-dimethoxyphenyl)methyl]-5-oxo-7H-pyrrolo[3,4-d]pyrimidin-4-yl]amino]phenyl]-2,4-dioxo-1,3-thiazolidine-3-carboxylate |
|---|---|
| PubChem CID | 118347992 |
| Molecular Formula | C35H31F2N5O7S |
| Molecular Weight | 703.72 g/mol |
| Exact Mass | 703.19 |
| IUPAC Name | tert-butyl 5-[4-[[2-(2,6-difluorophenyl)-6-[(2,4-dimethoxyphenyl)methyl]-5-oxo-7H-pyrrolo[3,4-d]pyrimidin-4-yl]amino]phenyl]-2,4-dioxo-1,3-thiazolidine-3-carboxylate |
| SMILES | COc1ccc(CN2Cc3nc(-c4c(F)cccc4F)nc(Nc4ccc(C5SC(=O)N(C(=O)OC(C)(C)C)C5=O)cc4)c3C2=O)c(OC)c1 |
| InChI | InChI=1S/C35H31F2N5O7S/c1-35(2,3)49-33(45)42-32(44)28(50-34(42)46)18-9-12-20(13-10-18)38-30-27-24(39-29(40-30)26-22(36)7-6-8-23(26)37)17-41(31(27)43)16-19-11-14-21(47-4)15-25(19)48-5/h6-15,28H,16-17H2,1-5H3,(H,38,39,40) |
| InChIKey | YDCSSWVGAMXQDG-UHFFFAOYSA-N |
| XLogP | 7.01 |
| TPSA | 140.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 703.72 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|