C33H33F2N5O4 — CID 118348105
2-(2,6-difluorophenyl)-6-[(2,4-dimethoxyphenyl)methyl]-4-[[5-[(3R,5R)-3,5-dimethylmorpholin-4-yl]-2-pyridinyl]amino]-7H-pyrrolo[3,4-b]pyridin-5-one (PubChem CID 118348105) has the molecular formula C33H33F2N5O4 and a molecular weight of 601.65 g/mol. Its IUPAC name is 2-(2,6-difluorophenyl)-6-[(2,4-dimethoxyphenyl)methyl]-4-[[5-[(3R,5R)-3,5-dimethylmorpholin-4-yl]-2-pyridinyl]amino]-7H-pyrrolo[3,4-b]pyridin-5-one.
| Compound Name | 2-(2,6-difluorophenyl)-6-[(2,4-dimethoxyphenyl)methyl]-4-[[5-[(3R,5R)-3,5-dimethylmorpholin-4-yl]-2-pyridinyl]amino]-7H-pyrrolo[3,4-b]pyridin-5-one |
|---|---|
| PubChem CID | 118348105 |
| Molecular Formula | C33H33F2N5O4 |
| Molecular Weight | 601.65 g/mol |
| Exact Mass | 601.25 |
| IUPAC Name | 2-(2,6-difluorophenyl)-6-[(2,4-dimethoxyphenyl)methyl]-4-[[5-[(3R,5R)-3,5-dimethylmorpholin-4-yl]-2-pyridinyl]amino]-7H-pyrrolo[3,4-b]pyridin-5-one |
| SMILES | COc1ccc(CN2Cc3nc(-c4c(F)cccc4F)cc(Nc4ccc(N5[C@H](C)COC[C@H]5C)cn4)c3C2=O)c(OC)c1 |
| InChI | InChI=1S/C33H33F2N5O4/c1-19-17-44-18-20(2)40(19)22-9-11-30(36-14-22)38-27-13-26(31-24(34)6-5-7-25(31)35)37-28-16-39(33(41)32(27)28)15-21-8-10-23(42-3)12-29(21)43-4/h5-14,19-20H,15-18H2,1-4H3,(H,36,37,38)/t19-,20-/m1/s1 |
| InChIKey | QZMFYZKSQKWTBB-WOJBJXKFSA-N |
| XLogP | 5.95 |
| TPSA | 89.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.65 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |