C34H34F2N6O4 — CID 118348319
2-(2,6-difluorophenyl)-6-[(2,4-dimethoxyphenyl)methyl]-4-[4-(1,2,4-trimethyl-3-oxopiperazin-2-yl)anilino]-7H-pyrrolo[3,4-d]pyrimidin-5-one (PubChem CID 118348319) has the molecular formula C34H34F2N6O4 and a molecular weight of 628.68 g/mol. Its IUPAC name is 2-(2,6-difluorophenyl)-6-[(2,4-dimethoxyphenyl)methyl]-4-[4-(1,2,4-trimethyl-3-oxopiperazin-2-yl)anilino]-7H-pyrrolo[3,4-d]pyrimidin-5-one.
| Compound Name | 2-(2,6-difluorophenyl)-6-[(2,4-dimethoxyphenyl)methyl]-4-[4-(1,2,4-trimethyl-3-oxopiperazin-2-yl)anilino]-7H-pyrrolo[3,4-d]pyrimidin-5-one |
|---|---|
| PubChem CID | 118348319 |
| Molecular Formula | C34H34F2N6O4 |
| Molecular Weight | 628.68 g/mol |
| Exact Mass | 628.26 |
| IUPAC Name | 2-(2,6-difluorophenyl)-6-[(2,4-dimethoxyphenyl)methyl]-4-[4-(1,2,4-trimethyl-3-oxopiperazin-2-yl)anilino]-7H-pyrrolo[3,4-d]pyrimidin-5-one |
| SMILES | COc1ccc(CN2Cc3nc(-c4c(F)cccc4F)nc(Nc4ccc(C5(C)C(=O)N(C)CCN5C)cc4)c3C2=O)c(OC)c1 |
| InChI | InChI=1S/C34H34F2N6O4/c1-34(33(44)40(2)15-16-41(34)3)21-10-12-22(13-11-21)37-31-29-26(38-30(39-31)28-24(35)7-6-8-25(28)36)19-42(32(29)43)18-20-9-14-23(45-4)17-27(20)46-5/h6-14,17H,15-16,18-19H2,1-5H3,(H,37,38,39) |
| InChIKey | VWUVAQNSNILATD-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 100.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.68 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |