C35H35F2N5O4 — CID 118348329
2-(2,6-difluorophenyl)-6-[(2,4-dimethoxyphenyl)methyl]-4-[4-[(3S)-1,3,5,5-tetramethyl-2-oxopyrrolidin-3-yl]anilino]-7H-pyrrolo[3,4-d]pyrimidin-5-one (PubChem CID 118348329) has the molecular formula C35H35F2N5O4 and a molecular weight of 627.69 g/mol. Its IUPAC name is 2-(2,6-difluorophenyl)-6-[(2,4-dimethoxyphenyl)methyl]-4-[4-[(3S)-1,3,5,5-tetramethyl-2-oxopyrrolidin-3-yl]anilino]-7H-pyrrolo[3,4-d]pyrimidin-5-one.
| Compound Name | 2-(2,6-difluorophenyl)-6-[(2,4-dimethoxyphenyl)methyl]-4-[4-[(3S)-1,3,5,5-tetramethyl-2-oxopyrrolidin-3-yl]anilino]-7H-pyrrolo[3,4-d]pyrimidin-5-one |
|---|---|
| PubChem CID | 118348329 |
| Molecular Formula | C35H35F2N5O4 |
| Molecular Weight | 627.69 g/mol |
| Exact Mass | 627.27 |
| IUPAC Name | 2-(2,6-difluorophenyl)-6-[(2,4-dimethoxyphenyl)methyl]-4-[4-[(3S)-1,3,5,5-tetramethyl-2-oxopyrrolidin-3-yl]anilino]-7H-pyrrolo[3,4-d]pyrimidin-5-one |
| SMILES | COc1ccc(CN2Cc3nc(-c4c(F)cccc4F)nc(Nc4ccc([C@]5(C)CC(C)(C)N(C)C5=O)cc4)c3C2=O)c(OC)c1 |
| InChI | InChI=1S/C35H35F2N5O4/c1-34(2)19-35(3,33(44)41(34)4)21-11-13-22(14-12-21)38-31-29-26(39-30(40-31)28-24(36)8-7-9-25(28)37)18-42(32(29)43)17-20-10-15-23(45-5)16-27(20)46-6/h7-16H,17-19H2,1-6H3,(H,38,39,40)/t35-/m0/s1 |
| InChIKey | CDNOATBHGYQPSD-DHUJRADRSA-N |
| XLogP | 6.24 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.69 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |