About N,5,6-trimethyl-3,4-dihydro-2H-pyran-4-amine
N,5,6-trimethyl-3,4-dihydro-2H-pyran-4-amine (PubChem CID 118348558) has the molecular formula C8H15NO
and a molecular weight of 141.21 g/mol. Its IUPAC name is N,5,6-trimethyl-3,4-dihydro-2H-pyran-4-amine.
Molecular Properties
| Compound Name | N,5,6-trimethyl-3,4-dihydro-2H-pyran-4-amine |
| PubChem CID | 118348558 |
| Molecular Formula | C8H15NO |
| Molecular Weight | 141.21 g/mol |
| Exact Mass | 141.12 |
| IUPAC Name | N,5,6-trimethyl-3,4-dihydro-2H-pyran-4-amine |
| SMILES | CNC1CCOC(C)=C1C |
| InChI | InChI=1S/C8H15NO/c1-6-7(2)10-5-4-8(6)9-3/h8-9H,4-5H2,1-3H3 |
| InChIKey | DPSSLYLYICPQIQ-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 141.21 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N,5,6-trimethyl-3,4-dihydro-2H-pyran-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,5,6-trimethyl-3,4-dihydro-2H-pyran-4-amine?
The IUPAC name of N,5,6-trimethyl-3,4-dihydro-2H-pyran-4-amine (CID 118348558) is N,5,6-trimethyl-3,4-dihydro-2H-pyran-4-amine.
What is the SMILES notation for N,5,6-trimethyl-3,4-dihydro-2H-pyran-4-amine?
The canonical SMILES for N,5,6-trimethyl-3,4-dihydro-2H-pyran-4-amine is CNC1CCOC(C)=C1C.
What is the InChIKey of N,5,6-trimethyl-3,4-dihydro-2H-pyran-4-amine?
The InChIKey is DPSSLYLYICPQIQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15NO/c1-6-7(2)10-5-4-8(6)9-3/h8-9H,4-5H2,1-3H3.
What are the key properties of N,5,6-trimethyl-3,4-dihydro-2H-pyran-4-amine?
N,5,6-trimethyl-3,4-dihydro-2H-pyran-4-amine has a molecular weight of 141.21 g/mol, XLogP of 1.29, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N,5,6-trimethyl-3,4-dihydro-2H-pyran-4-amine is sourced from PubChem (CID 118348558), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).