About (3-methylsulfanyl-5,6-dihydrobenzo[b][1]benzothiepin-5-yl) acetate
(3-methylsulfanyl-5,6-dihydrobenzo[b][1]benzothiepin-5-yl) acetate (PubChem CID 11834856) has the molecular formula C17H16O2S2
and a molecular weight of 316.45 g/mol. Its IUPAC name is (3-methylsulfanyl-5,6-dihydrobenzo[b][1]benzothiepin-5-yl) acetate.
Molecular Properties
| Compound Name | (3-methylsulfanyl-5,6-dihydrobenzo[b][1]benzothiepin-5-yl) acetate |
| PubChem CID | 11834856 |
| Molecular Formula | C17H16O2S2 |
| Molecular Weight | 316.45 g/mol |
| Exact Mass | 316.06 |
| IUPAC Name | (3-methylsulfanyl-5,6-dihydrobenzo[b][1]benzothiepin-5-yl) acetate |
| SMILES | CSc1ccc2c(c1)C(OC(C)=O)Cc1ccccc1S2 |
| InChI | InChI=1S/C17H16O2S2/c1-11(18)19-15-9-12-5-3-4-6-16(12)21-17-8-7-13(20-2)10-14(15)17/h3-8,10,15H,9H2,1-2H3 |
| InChIKey | CJAQFYXGOHXKEZ-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.45 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (3-methylsulfanyl-5,6-dihydrobenzo[b][1]benzothiepin-5-yl) acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-methylsulfanyl-5,6-dihydrobenzo[b][1]benzothiepin-5-yl) acetate?
The IUPAC name of (3-methylsulfanyl-5,6-dihydrobenzo[b][1]benzothiepin-5-yl) acetate (CID 11834856) is (3-methylsulfanyl-5,6-dihydrobenzo[b][1]benzothiepin-5-yl) acetate.
What is the SMILES notation for (3-methylsulfanyl-5,6-dihydrobenzo[b][1]benzothiepin-5-yl) acetate?
The canonical SMILES for (3-methylsulfanyl-5,6-dihydrobenzo[b][1]benzothiepin-5-yl) acetate is CSc1ccc2c(c1)C(OC(C)=O)Cc1ccccc1S2.
What is the InChIKey of (3-methylsulfanyl-5,6-dihydrobenzo[b][1]benzothiepin-5-yl) acetate?
The InChIKey is CJAQFYXGOHXKEZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16O2S2/c1-11(18)19-15-9-12-5-3-4-6-16(12)21-17-8-7-13(20-2)10-14(15)17/h3-8,10,15H,9H2,1-2H3.
What are the key properties of (3-methylsulfanyl-5,6-dihydrobenzo[b][1]benzothiepin-5-yl) acetate?
(3-methylsulfanyl-5,6-dihydrobenzo[b][1]benzothiepin-5-yl) acetate has a molecular weight of 316.45 g/mol, XLogP of 4.72, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3-methylsulfanyl-5,6-dihydrobenzo[b][1]benzothiepin-5-yl) acetate is sourced from PubChem (CID 11834856), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).