About N,5,6-trimethyl-1,2,3,4-tetrahydropyridin-4-amine
N,5,6-trimethyl-1,2,3,4-tetrahydropyridin-4-amine (PubChem CID 118348561) has the molecular formula C8H16N2
and a molecular weight of 140.23 g/mol. Its IUPAC name is N,5,6-trimethyl-1,2,3,4-tetrahydropyridin-4-amine.
Analyze N,5,6-trimethyl-1,2,3,4-tetrahydropyridin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,5,6-trimethyl-1,2,3,4-tetrahydropyridin-4-amine?
The IUPAC name of N,5,6-trimethyl-1,2,3,4-tetrahydropyridin-4-amine (CID 118348561) is N,5,6-trimethyl-1,2,3,4-tetrahydropyridin-4-amine.
What is the SMILES notation for N,5,6-trimethyl-1,2,3,4-tetrahydropyridin-4-amine?
The canonical SMILES for N,5,6-trimethyl-1,2,3,4-tetrahydropyridin-4-amine is CNC1CCNC(C)=C1C.
What is the InChIKey of N,5,6-trimethyl-1,2,3,4-tetrahydropyridin-4-amine?
The InChIKey is LTXYPVCPFINUSC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16N2/c1-6-7(2)10-5-4-8(6)9-3/h8-10H,4-5H2,1-3H3.
What are the key properties of N,5,6-trimethyl-1,2,3,4-tetrahydropyridin-4-amine?
N,5,6-trimethyl-1,2,3,4-tetrahydropyridin-4-amine has a molecular weight of 140.23 g/mol, XLogP of 0.86, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N,5,6-trimethyl-1,2,3,4-tetrahydropyridin-4-amine is sourced from PubChem (CID 118348561), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).