C20H29NO — CID 118348866
N-[(2E,4E,8E,10Z)-5,8-dimethyldodeca-2,4,8,10-tetraen-6-yn-2-yl]-3,3-dimethylbutanamide (PubChem CID 118348866) has the molecular formula C20H29NO and a molecular weight of 299.46 g/mol. Its IUPAC name is N-[(2E,4E,8E,10Z)-5,8-dimethyldodeca-2,4,8,10-tetraen-6-yn-2-yl]-3,3-dimethylbutanamide.
| Compound Name | N-[(2E,4E,8E,10Z)-5,8-dimethyldodeca-2,4,8,10-tetraen-6-yn-2-yl]-3,3-dimethylbutanamide |
|---|---|
| PubChem CID | 118348866 |
| Molecular Formula | C20H29NO |
| Molecular Weight | 299.46 g/mol |
| Exact Mass | 299.22 |
| IUPAC Name | N-[(2E,4E,8E,10Z)-5,8-dimethyldodeca-2,4,8,10-tetraen-6-yn-2-yl]-3,3-dimethylbutanamide |
| SMILES | C/C=C\C=C(/C)C#C/C(C)=C/C=C(\C)NC(=O)CC(C)(C)C |
| InChI | InChI=1S/C20H29NO/c1-8-9-10-16(2)11-12-17(3)13-14-18(4)21-19(22)15-20(5,6)7/h8-10,13-14H,15H2,1-7H3,(H,21,22)/b9-8-,16-10+,17-13+,18-14+ |
| InChIKey | SDDHAUAKBLWMRR-ZPWGNANJSA-N |
| XLogP | 4.91 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.46 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|