C44H48FNO4 — CID 118349109
[(Z)-[1-(2,5-dimethylphenyl)-2-[7-(4-fluorobenzoyl)-9,9-dihexylfluoren-2-yl]-2-oxoethylidene]amino] acetate (PubChem CID 118349109) has the molecular formula C44H48FNO4 and a molecular weight of 673.87 g/mol. Its IUPAC name is [(Z)-[1-(2,5-dimethylphenyl)-2-[7-(4-fluorobenzoyl)-9,9-dihexylfluoren-2-yl]-2-oxoethylidene]amino] acetate.
| Compound Name | [(Z)-[1-(2,5-dimethylphenyl)-2-[7-(4-fluorobenzoyl)-9,9-dihexylfluoren-2-yl]-2-oxoethylidene]amino] acetate |
|---|---|
| PubChem CID | 118349109 |
| Molecular Formula | C44H48FNO4 |
| Molecular Weight | 673.87 g/mol |
| Exact Mass | 673.36 |
| IUPAC Name | [(Z)-[1-(2,5-dimethylphenyl)-2-[7-(4-fluorobenzoyl)-9,9-dihexylfluoren-2-yl]-2-oxoethylidene]amino] acetate |
| SMILES | CCCCCCC1(CCCCCC)c2cc(C(=O)/C(=N\OC(C)=O)c3cc(C)ccc3C)ccc2-c2ccc(C(=O)c3ccc(F)cc3)cc21 |
| InChI | InChI=1S/C44H48FNO4/c1-6-8-10-12-24-44(25-13-11-9-7-2)39-27-33(42(48)32-16-20-35(45)21-17-32)18-22-36(39)37-23-19-34(28-40(37)44)43(49)41(46-50-31(5)47)38-26-29(3)14-15-30(38)4/h14-23,26-28H,6-13,24-25H2,1-5H3/b46-41- |
| InChIKey | YYTARQGMTKGHHZ-CUYMMVOQSA-N |
| XLogP | 11.03 |
| TPSA | 72.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.87 |
| LogP ≤ 5 | 11.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|