C23H23F6NO2 — CID 118349113
[(E)-1-[9,9-bis(3,3,3-trifluoropropyl)-8,8a-dihydrofluoren-2-yl]ethylideneamino] acetate (PubChem CID 118349113) has the molecular formula C23H23F6NO2 and a molecular weight of 459.43 g/mol. Its IUPAC name is [(E)-1-[9,9-bis(3,3,3-trifluoropropyl)-8,8a-dihydrofluoren-2-yl]ethylideneamino] acetate.
| Compound Name | [(E)-1-[9,9-bis(3,3,3-trifluoropropyl)-8,8a-dihydrofluoren-2-yl]ethylideneamino] acetate |
|---|---|
| PubChem CID | 118349113 |
| Molecular Formula | C23H23F6NO2 |
| Molecular Weight | 459.43 g/mol |
| Exact Mass | 459.16 |
| IUPAC Name | [(E)-1-[9,9-bis(3,3,3-trifluoropropyl)-8,8a-dihydrofluoren-2-yl]ethylideneamino] acetate |
| SMILES | CC(=O)O/N=C(\C)c1ccc2c(c1)C(CCC(F)(F)F)(CCC(F)(F)F)C1CC=CC=C21 |
| InChI | InChI=1S/C23H23F6NO2/c1-14(30-32-15(2)31)16-7-8-18-17-5-3-4-6-19(17)21(20(18)13-16,9-11-22(24,25)26)10-12-23(27,28)29/h3-5,7-8,13,19H,6,9-12H2,1-2H3/b30-14+ |
| InChIKey | MJTMOYRCPSKSLJ-AMVVHIIESA-N |
| XLogP | 6.87 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.43 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|