About [5-[1-[N-ethyl-3,5-bis(trifluoromethyl)anilino]ethyl]-2-methylphenyl]methanol
[5-[1-[N-ethyl-3,5-bis(trifluoromethyl)anilino]ethyl]-2-methylphenyl]methanol (PubChem CID 118349198) has the molecular formula C20H21F6NO
and a molecular weight of 405.38 g/mol. Its IUPAC name is [5-[1-[N-ethyl-3,5-bis(trifluoromethyl)anilino]ethyl]-2-methylphenyl]methanol.
Molecular Properties
| Compound Name | [5-[1-[N-ethyl-3,5-bis(trifluoromethyl)anilino]ethyl]-2-methylphenyl]methanol |
| PubChem CID | 118349198 |
| Molecular Formula | C20H21F6NO |
| Molecular Weight | 405.38 g/mol |
| Exact Mass | 405.15 |
| IUPAC Name | [5-[1-[N-ethyl-3,5-bis(trifluoromethyl)anilino]ethyl]-2-methylphenyl]methanol |
| SMILES | CCN(c1cc(C(F)(F)F)cc(C(F)(F)F)c1)C(C)c1ccc(C)c(CO)c1 |
| InChI | InChI=1S/C20H21F6NO/c1-4-27(13(3)14-6-5-12(2)15(7-14)11-28)18-9-16(19(21,22)23)8-17(10-18)20(24,25)26/h5-10,13,28H,4,11H2,1-3H3 |
| InChIKey | MDDOWJMKOFYCRH-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 405.38 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [5-[1-[N-ethyl-3,5-bis(trifluoromethyl)anilino]ethyl]-2-methylphenyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-[1-[N-ethyl-3,5-bis(trifluoromethyl)anilino]ethyl]-2-methylphenyl]methanol?
The IUPAC name of [5-[1-[N-ethyl-3,5-bis(trifluoromethyl)anilino]ethyl]-2-methylphenyl]methanol (CID 118349198) is [5-[1-[N-ethyl-3,5-bis(trifluoromethyl)anilino]ethyl]-2-methylphenyl]methanol.
What is the SMILES notation for [5-[1-[N-ethyl-3,5-bis(trifluoromethyl)anilino]ethyl]-2-methylphenyl]methanol?
The canonical SMILES for [5-[1-[N-ethyl-3,5-bis(trifluoromethyl)anilino]ethyl]-2-methylphenyl]methanol is CCN(c1cc(C(F)(F)F)cc(C(F)(F)F)c1)C(C)c1ccc(C)c(CO)c1.
What is the InChIKey of [5-[1-[N-ethyl-3,5-bis(trifluoromethyl)anilino]ethyl]-2-methylphenyl]methanol?
The InChIKey is MDDOWJMKOFYCRH-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H21F6NO/c1-4-27(13(3)14-6-5-12(2)15(7-14)11-28)18-9-16(19(21,22)23)8-17(10-18)20(24,25)26/h5-10,13,28H,4,11H2,1-3H3.
What are the key properties of [5-[1-[N-ethyl-3,5-bis(trifluoromethyl)anilino]ethyl]-2-methylphenyl]methanol?
[5-[1-[N-ethyl-3,5-bis(trifluoromethyl)anilino]ethyl]-2-methylphenyl]methanol has a molecular weight of 405.38 g/mol, XLogP of 6.11, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [5-[1-[N-ethyl-3,5-bis(trifluoromethyl)anilino]ethyl]-2-methylphenyl]methanol is sourced from PubChem (CID 118349198), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).