About (1S,2R)-1-methylcyclohex-4-ene-1,2-dicarboxylic acid
(1S,2R)-1-methylcyclohex-4-ene-1,2-dicarboxylic acid (PubChem CID 11834952) has the molecular formula C9H12O4
and a molecular weight of 184.19 g/mol. Its IUPAC name is (1S,2R)-1-methylcyclohex-4-ene-1,2-dicarboxylic acid.
Molecular Properties
| Compound Name | (1S,2R)-1-methylcyclohex-4-ene-1,2-dicarboxylic acid |
| PubChem CID | 11834952 |
| Molecular Formula | C9H12O4 |
| Molecular Weight | 184.19 g/mol |
| Exact Mass | 184.07 |
| IUPAC Name | (1S,2R)-1-methylcyclohex-4-ene-1,2-dicarboxylic acid |
| SMILES | C[C@]1(C(=O)O)CC=CC[C@H]1C(=O)O |
| InChI | InChI=1S/C9H12O4/c1-9(8(12)13)5-3-2-4-6(9)7(10)11/h2-3,6H,4-5H2,1H3,(H,10,11)(H,12,13)/t6-,9-/m0/s1 |
| InChIKey | IIOYAXLMGNWCQN-RCOVLWMOSA-N |
| XLogP | 1.13 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.19 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (1S,2R)-1-methylcyclohex-4-ene-1,2-dicarboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S,2R)-1-methylcyclohex-4-ene-1,2-dicarboxylic acid?
The IUPAC name of (1S,2R)-1-methylcyclohex-4-ene-1,2-dicarboxylic acid (CID 11834952) is (1S,2R)-1-methylcyclohex-4-ene-1,2-dicarboxylic acid.
What is the SMILES notation for (1S,2R)-1-methylcyclohex-4-ene-1,2-dicarboxylic acid?
The canonical SMILES for (1S,2R)-1-methylcyclohex-4-ene-1,2-dicarboxylic acid is C[C@]1(C(=O)O)CC=CC[C@H]1C(=O)O.
What is the InChIKey of (1S,2R)-1-methylcyclohex-4-ene-1,2-dicarboxylic acid?
The InChIKey is IIOYAXLMGNWCQN-RCOVLWMOSA-N. The full InChI is InChI=1S/C9H12O4/c1-9(8(12)13)5-3-2-4-6(9)7(10)11/h2-3,6H,4-5H2,1H3,(H,10,11)(H,12,13)/t6-,9-/m0/s1.
What are the key properties of (1S,2R)-1-methylcyclohex-4-ene-1,2-dicarboxylic acid?
(1S,2R)-1-methylcyclohex-4-ene-1,2-dicarboxylic acid has a molecular weight of 184.19 g/mol, XLogP of 1.13, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1S,2R)-1-methylcyclohex-4-ene-1,2-dicarboxylic acid is sourced from PubChem (CID 11834952), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).