About [(1S,2S)-2-prop-2-enylcyclohexyl]hydrazine
[(1S,2S)-2-prop-2-enylcyclohexyl]hydrazine (PubChem CID 118349725) has the molecular formula C9H18N2
and a molecular weight of 154.26 g/mol. Its IUPAC name is [(1S,2S)-2-prop-2-enylcyclohexyl]hydrazine.
Molecular Properties
| Compound Name | [(1S,2S)-2-prop-2-enylcyclohexyl]hydrazine |
| PubChem CID | 118349725 |
| Molecular Formula | C9H18N2 |
| Molecular Weight | 154.26 g/mol |
| Exact Mass | 154.15 |
| IUPAC Name | [(1S,2S)-2-prop-2-enylcyclohexyl]hydrazine |
| SMILES | C=CC[C@@H]1CCCC[C@@H]1NN |
| InChI | InChI=1S/C9H18N2/c1-2-5-8-6-3-4-7-9(8)11-10/h2,8-9,11H,1,3-7,10H2/t8-,9+/m1/s1 |
| InChIKey | GJYZXQSOWFKCAW-BDAKNGLRSA-N |
| XLogP | 1.58 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.26 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [(1S,2S)-2-prop-2-enylcyclohexyl]hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1S,2S)-2-prop-2-enylcyclohexyl]hydrazine?
The IUPAC name of [(1S,2S)-2-prop-2-enylcyclohexyl]hydrazine (CID 118349725) is [(1S,2S)-2-prop-2-enylcyclohexyl]hydrazine.
What is the SMILES notation for [(1S,2S)-2-prop-2-enylcyclohexyl]hydrazine?
The canonical SMILES for [(1S,2S)-2-prop-2-enylcyclohexyl]hydrazine is C=CC[C@@H]1CCCC[C@@H]1NN.
What is the InChIKey of [(1S,2S)-2-prop-2-enylcyclohexyl]hydrazine?
The InChIKey is GJYZXQSOWFKCAW-BDAKNGLRSA-N. The full InChI is InChI=1S/C9H18N2/c1-2-5-8-6-3-4-7-9(8)11-10/h2,8-9,11H,1,3-7,10H2/t8-,9+/m1/s1.
What are the key properties of [(1S,2S)-2-prop-2-enylcyclohexyl]hydrazine?
[(1S,2S)-2-prop-2-enylcyclohexyl]hydrazine has a molecular weight of 154.26 g/mol, XLogP of 1.58, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(1S,2S)-2-prop-2-enylcyclohexyl]hydrazine is sourced from PubChem (CID 118349725), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).