C14H24Cl2N2O — CID 118349732
(E,3E)-2-chloro-3-(1-chloro-2-methoxyprop-2-enylidene)-N'-(2,2-dimethylpropyl)pent-1-ene-1,5-diamine (PubChem CID 118349732) has the molecular formula C14H24Cl2N2O and a molecular weight of 307.27 g/mol. Its IUPAC name is (E,3E)-2-chloro-3-(1-chloro-2-methoxyprop-2-enylidene)-N'-(2,2-dimethylpropyl)pent-1-ene-1,5-diamine.
| Compound Name | (E,3E)-2-chloro-3-(1-chloro-2-methoxyprop-2-enylidene)-N'-(2,2-dimethylpropyl)pent-1-ene-1,5-diamine |
|---|---|
| PubChem CID | 118349732 |
| Molecular Formula | C14H24Cl2N2O |
| Molecular Weight | 307.27 g/mol |
| Exact Mass | 306.13 |
| IUPAC Name | (E,3E)-2-chloro-3-(1-chloro-2-methoxyprop-2-enylidene)-N'-(2,2-dimethylpropyl)pent-1-ene-1,5-diamine |
| SMILES | C=C(OC)/C(Cl)=C(CCNCC(C)(C)C)\C(Cl)=C/N |
| InChI | InChI=1S/C14H24Cl2N2O/c1-10(19-5)13(16)11(12(15)8-17)6-7-18-9-14(2,3)4/h8,18H,1,6-7,9,17H2,2-5H3/b12-8+,13-11+ |
| InChIKey | KUAGRDOBDQJRAA-UHSWXSRBSA-N |
| XLogP | 3.70 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.27 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|