C23H24FN7O2S — CID 118350017
methyl 5-[[4-[(1R,4R,5R)-5-amino-2-bicyclo[2.2.1]heptanyl]-6-fluoro-8-(methylamino)-9H-pyrimido[4,5-b]indol-2-yl]amino]-1,3-thiazole-2-carboxylate (PubChem CID 118350017) has the molecular formula C23H24FN7O2S and a molecular weight of 481.56 g/mol. Its IUPAC name is methyl 5-[[4-[(1R,4R,5R)-5-amino-2-bicyclo[2.2.1]heptanyl]-6-fluoro-8-(methylamino)-9H-pyrimido[4,5-b]indol-2-yl]amino]-1,3-thiazole-2-carboxylate.
| Compound Name | methyl 5-[[4-[(1R,4R,5R)-5-amino-2-bicyclo[2.2.1]heptanyl]-6-fluoro-8-(methylamino)-9H-pyrimido[4,5-b]indol-2-yl]amino]-1,3-thiazole-2-carboxylate |
|---|---|
| PubChem CID | 118350017 |
| Molecular Formula | C23H24FN7O2S |
| Molecular Weight | 481.56 g/mol |
| Exact Mass | 481.17 |
| IUPAC Name | methyl 5-[[4-[(1R,4R,5R)-5-amino-2-bicyclo[2.2.1]heptanyl]-6-fluoro-8-(methylamino)-9H-pyrimido[4,5-b]indol-2-yl]amino]-1,3-thiazole-2-carboxylate |
| SMILES | CNc1cc(F)cc2c1[nH]c1nc(Nc3cnc(C(=O)OC)s3)nc(C3C[C@H]4C[C@@H]3C[C@H]4N)c12 |
| InChI | InChI=1S/C23H24FN7O2S/c1-26-15-7-11(24)6-13-17-19(12-4-10-3-9(12)5-14(10)25)30-23(31-20(17)29-18(13)15)28-16-8-27-21(34-16)22(32)33-2/h6-10,12,14,26H,3-5,25H2,1-2H3,(H2,28,29,30,31)/t9-,10-,12?,14-/m1/s1 |
| InChIKey | WEWWUBCPUUVALT-QTQSFLCGSA-N |
| XLogP | 4.12 |
| TPSA | 130.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.56 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |