C25H24FN7OS2 — CID 118350037
4-[(1R,4R,5R)-5-amino-2-bicyclo[2.2.1]heptanyl]-6-fluoro-N-methyl-2-[[2-(5-methyl-1,3-oxazol-2-yl)-1,3-thiazol-5-yl]sulfanyl]-9H-pyrimido[4,5-b]indol-8-amine (PubChem CID 118350037) has the molecular formula C25H24FN7OS2 and a molecular weight of 521.65 g/mol. Its IUPAC name is 4-[(1R,4R,5R)-5-amino-2-bicyclo[2.2.1]heptanyl]-6-fluoro-N-methyl-2-[[2-(5-methyl-1,3-oxazol-2-yl)-1,3-thiazol-5-yl]sulfanyl]-9H-pyrimido[4,5-b]indol-8-amine.
| Compound Name | 4-[(1R,4R,5R)-5-amino-2-bicyclo[2.2.1]heptanyl]-6-fluoro-N-methyl-2-[[2-(5-methyl-1,3-oxazol-2-yl)-1,3-thiazol-5-yl]sulfanyl]-9H-pyrimido[4,5-b]indol-8-amine |
|---|---|
| PubChem CID | 118350037 |
| Molecular Formula | C25H24FN7OS2 |
| Molecular Weight | 521.65 g/mol |
| Exact Mass | 521.15 |
| IUPAC Name | 4-[(1R,4R,5R)-5-amino-2-bicyclo[2.2.1]heptanyl]-6-fluoro-N-methyl-2-[[2-(5-methyl-1,3-oxazol-2-yl)-1,3-thiazol-5-yl]sulfanyl]-9H-pyrimido[4,5-b]indol-8-amine |
| SMILES | CNc1cc(F)cc2c1[nH]c1nc(Sc3cnc(-c4ncc(C)o4)s3)nc(C3C[C@H]4C[C@@H]3C[C@H]4N)c12 |
| InChI | InChI=1S/C25H24FN7OS2/c1-10-8-29-23(34-10)24-30-9-18(35-24)36-25-32-21(14-4-12-3-11(14)5-16(12)27)19-15-6-13(26)7-17(28-2)20(15)31-22(19)33-25/h6-9,11-12,14,16,28H,3-5,27H2,1-2H3,(H,31,32,33)/t11-,12-,14?,16-/m1/s1 |
| InChIKey | FHPYDKNGLLBOMA-NZQXWLTISA-N |
| XLogP | 5.70 |
| TPSA | 118.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.65 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |