C23H24FN7O2S2 — CID 118350092
ethyl 2-[[4-[(1R,4R,5R)-5-amino-2-azabicyclo[2.2.1]heptan-2-yl]-6-fluoro-8-(methylamino)-9H-pyrimido[4,5-b]indol-2-yl]sulfanyl]-1,3-thiazole-4-carboxylate (PubChem CID 118350092) has the molecular formula C23H24FN7O2S2 and a molecular weight of 513.62 g/mol. Its IUPAC name is ethyl 2-[[4-[(1R,4R,5R)-5-amino-2-azabicyclo[2.2.1]heptan-2-yl]-6-fluoro-8-(methylamino)-9H-pyrimido[4,5-b]indol-2-yl]sulfanyl]-1,3-thiazole-4-carboxylate.
| Compound Name | ethyl 2-[[4-[(1R,4R,5R)-5-amino-2-azabicyclo[2.2.1]heptan-2-yl]-6-fluoro-8-(methylamino)-9H-pyrimido[4,5-b]indol-2-yl]sulfanyl]-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 118350092 |
| Molecular Formula | C23H24FN7O2S2 |
| Molecular Weight | 513.62 g/mol |
| Exact Mass | 513.14 |
| IUPAC Name | ethyl 2-[[4-[(1R,4R,5R)-5-amino-2-azabicyclo[2.2.1]heptan-2-yl]-6-fluoro-8-(methylamino)-9H-pyrimido[4,5-b]indol-2-yl]sulfanyl]-1,3-thiazole-4-carboxylate |
| SMILES | CCOC(=O)c1csc(Sc2nc(N3C[C@H]4C[C@@H]3C[C@H]4N)c3c(n2)[nH]c2c(NC)cc(F)cc23)n1 |
| InChI | InChI=1S/C23H24FN7O2S2/c1-3-33-21(32)16-9-34-23(27-16)35-22-29-19-17(13-5-11(24)6-15(26-2)18(13)28-19)20(30-22)31-8-10-4-12(31)7-14(10)25/h5-6,9-10,12,14,26H,3-4,7-8,25H2,1-2H3,(H,28,29,30)/t10-,12-,14-/m1/s1 |
| InChIKey | SQWNAVFNGBHZRS-MPKXVKKWSA-N |
| XLogP | 4.00 |
| TPSA | 122.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.62 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |