C24H22N2O3 — CID 118350170
(3E)-3-[(3,4-dimethyl-5-oxo-1-phenyl-2H-pyrrol-2-yl)oxymethylidene]-1,3a,4,8b-tetrahydroindeno[1,2-b]pyrrol-2-one (PubChem CID 118350170) has the molecular formula C24H22N2O3 and a molecular weight of 386.45 g/mol. Its IUPAC name is (3E)-3-[(3,4-dimethyl-5-oxo-1-phenyl-2H-pyrrol-2-yl)oxymethylidene]-1,3a,4,8b-tetrahydroindeno[1,2-b]pyrrol-2-one.
| Compound Name | (3E)-3-[(3,4-dimethyl-5-oxo-1-phenyl-2H-pyrrol-2-yl)oxymethylidene]-1,3a,4,8b-tetrahydroindeno[1,2-b]pyrrol-2-one |
|---|---|
| PubChem CID | 118350170 |
| Molecular Formula | C24H22N2O3 |
| Molecular Weight | 386.45 g/mol |
| Exact Mass | 386.16 |
| IUPAC Name | (3E)-3-[(3,4-dimethyl-5-oxo-1-phenyl-2H-pyrrol-2-yl)oxymethylidene]-1,3a,4,8b-tetrahydroindeno[1,2-b]pyrrol-2-one |
| SMILES | CC1=C(C)C(O/C=C2/C(=O)NC3c4ccccc4CC23)N(c2ccccc2)C1=O |
| InChI | InChI=1S/C24H22N2O3/c1-14-15(2)24(26(23(14)28)17-9-4-3-5-10-17)29-13-20-19-12-16-8-6-7-11-18(16)21(19)25-22(20)27/h3-11,13,19,21,24H,12H2,1-2H3,(H,25,27)/b20-13+ |
| InChIKey | PAWUPVNIHIVKDK-DEDYPNTBSA-N |
| XLogP | 3.64 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.45 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|