About (E)-1-[4-(3,5-diphenyl-3,4-dihydropyrazol-2-yl)phenyl]-N-pyridin-2-ylmethanimine
(E)-1-[4-(3,5-diphenyl-3,4-dihydropyrazol-2-yl)phenyl]-N-pyridin-2-ylmethanimine (PubChem CID 11835018) has the molecular formula C27H22N4
and a molecular weight of 402.50 g/mol. Its IUPAC name is (E)-1-[4-(3,5-diphenyl-3,4-dihydropyrazol-2-yl)phenyl]-N-pyridin-2-ylmethanimine.
Molecular Properties
| Compound Name | (E)-1-[4-(3,5-diphenyl-3,4-dihydropyrazol-2-yl)phenyl]-N-pyridin-2-ylmethanimine |
| PubChem CID | 11835018 |
| Molecular Formula | C27H22N4 |
| Molecular Weight | 402.50 g/mol |
| Exact Mass | 402.18 |
| IUPAC Name | (E)-1-[4-(3,5-diphenyl-3,4-dihydropyrazol-2-yl)phenyl]-N-pyridin-2-ylmethanimine |
| SMILES | C(=N/c1ccccn1)\c1ccc(N2N=C(c3ccccc3)CC2c2ccccc2)cc1 |
| InChI | InChI=1S/C27H22N4/c1-3-9-22(10-4-1)25-19-26(23-11-5-2-6-12-23)31(30-25)24-16-14-21(15-17-24)20-29-27-13-7-8-18-28-27/h1-18,20,26H,19H2/b29-20+ |
| InChIKey | RUWHZELCLVYWEJ-ZTKZIYFRSA-N |
| XLogP | 6.19 |
| TPSA | 40.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 402.50 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-1-[4-(3,5-diphenyl-3,4-dihydropyrazol-2-yl)phenyl]-N-pyridin-2-ylmethanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-1-[4-(3,5-diphenyl-3,4-dihydropyrazol-2-yl)phenyl]-N-pyridin-2-ylmethanimine?
The IUPAC name of (E)-1-[4-(3,5-diphenyl-3,4-dihydropyrazol-2-yl)phenyl]-N-pyridin-2-ylmethanimine (CID 11835018) is (E)-1-[4-(3,5-diphenyl-3,4-dihydropyrazol-2-yl)phenyl]-N-pyridin-2-ylmethanimine.
What is the SMILES notation for (E)-1-[4-(3,5-diphenyl-3,4-dihydropyrazol-2-yl)phenyl]-N-pyridin-2-ylmethanimine?
The canonical SMILES for (E)-1-[4-(3,5-diphenyl-3,4-dihydropyrazol-2-yl)phenyl]-N-pyridin-2-ylmethanimine is C(=N/c1ccccn1)\c1ccc(N2N=C(c3ccccc3)CC2c2ccccc2)cc1.
What is the InChIKey of (E)-1-[4-(3,5-diphenyl-3,4-dihydropyrazol-2-yl)phenyl]-N-pyridin-2-ylmethanimine?
The InChIKey is RUWHZELCLVYWEJ-ZTKZIYFRSA-N. The full InChI is InChI=1S/C27H22N4/c1-3-9-22(10-4-1)25-19-26(23-11-5-2-6-12-23)31(30-25)24-16-14-21(15-17-24)20-29-27-13-7-8-18-28-27/h1-18,20,26H,19H2/b29-20+.
What are the key properties of (E)-1-[4-(3,5-diphenyl-3,4-dihydropyrazol-2-yl)phenyl]-N-pyridin-2-ylmethanimine?
(E)-1-[4-(3,5-diphenyl-3,4-dihydropyrazol-2-yl)phenyl]-N-pyridin-2-ylmethanimine has a molecular weight of 402.50 g/mol, XLogP of 6.19, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-1-[4-(3,5-diphenyl-3,4-dihydropyrazol-2-yl)phenyl]-N-pyridin-2-ylmethanimine is sourced from PubChem (CID 11835018), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).