C32H40N6O3S — CID 118351133
4-[(1-methylcyclopropyl)methoxy]-5-[4-[(2-pent-1-en-2-yl-2,3-dihydro-1,3-benzoxazol-5-yl)methylamino]sulfanylpiperazin-1-yl]-2-phenylpyridazin-3-one (PubChem CID 118351133) has the molecular formula C32H40N6O3S and a molecular weight of 588.78 g/mol. Its IUPAC name is 4-[(1-methylcyclopropyl)methoxy]-5-[4-[(2-pent-1-en-2-yl-2,3-dihydro-1,3-benzoxazol-5-yl)methylamino]sulfanylpiperazin-1-yl]-2-phenylpyridazin-3-one.
| Compound Name | 4-[(1-methylcyclopropyl)methoxy]-5-[4-[(2-pent-1-en-2-yl-2,3-dihydro-1,3-benzoxazol-5-yl)methylamino]sulfanylpiperazin-1-yl]-2-phenylpyridazin-3-one |
|---|---|
| PubChem CID | 118351133 |
| Molecular Formula | C32H40N6O3S |
| Molecular Weight | 588.78 g/mol |
| Exact Mass | 588.29 |
| IUPAC Name | 4-[(1-methylcyclopropyl)methoxy]-5-[4-[(2-pent-1-en-2-yl-2,3-dihydro-1,3-benzoxazol-5-yl)methylamino]sulfanylpiperazin-1-yl]-2-phenylpyridazin-3-one |
| SMILES | C=C(CCC)C1Nc2cc(CNSN3CCN(c4cnn(-c5ccccc5)c(=O)c4OCC4(C)CC4)CC3)ccc2O1 |
| InChI | InChI=1S/C32H40N6O3S/c1-4-8-23(2)30-35-26-19-24(11-12-28(26)41-30)20-34-42-37-17-15-36(16-18-37)27-21-33-38(25-9-6-5-7-10-25)31(39)29(27)40-22-32(3)13-14-32/h5-7,9-12,19,21,30,34-35H,2,4,8,13-18,20,22H2,1,3H3 |
| InChIKey | JBIMCIMVXFSRII-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 83.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.78 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|