About 3-thiatricyclo[5.2.2.02,6]undeca-2(6),4-dien-4-amine
3-thiatricyclo[5.2.2.02,6]undeca-2(6),4-dien-4-amine (PubChem CID 118351265) has the molecular formula C10H13NS
and a molecular weight of 179.29 g/mol. Its IUPAC name is 3-thiatricyclo[5.2.2.02,6]undeca-2(6),4-dien-4-amine.
Molecular Properties
| Compound Name | 3-thiatricyclo[5.2.2.02,6]undeca-2(6),4-dien-4-amine |
| PubChem CID | 118351265 |
| Molecular Formula | C10H13NS |
| Molecular Weight | 179.29 g/mol |
| Exact Mass | 179.08 |
| IUPAC Name | 3-thiatricyclo[5.2.2.02,6]undeca-2(6),4-dien-4-amine |
| SMILES | Nc1cc2c(s1)C1CCC2CC1 |
| InChI | InChI=1S/C10H13NS/c11-9-5-8-6-1-3-7(4-2-6)10(8)12-9/h5-7H,1-4,11H2 |
| InChIKey | KDHPRKAICSAMHJ-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.29 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-thiatricyclo[5.2.2.02,6]undeca-2(6),4-dien-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-thiatricyclo[5.2.2.02,6]undeca-2(6),4-dien-4-amine?
The IUPAC name of 3-thiatricyclo[5.2.2.02,6]undeca-2(6),4-dien-4-amine (CID 118351265) is 3-thiatricyclo[5.2.2.02,6]undeca-2(6),4-dien-4-amine.
What is the SMILES notation for 3-thiatricyclo[5.2.2.02,6]undeca-2(6),4-dien-4-amine?
The canonical SMILES for 3-thiatricyclo[5.2.2.02,6]undeca-2(6),4-dien-4-amine is Nc1cc2c(s1)C1CCC2CC1.
What is the InChIKey of 3-thiatricyclo[5.2.2.02,6]undeca-2(6),4-dien-4-amine?
The InChIKey is KDHPRKAICSAMHJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13NS/c11-9-5-8-6-1-3-7(4-2-6)10(8)12-9/h5-7H,1-4,11H2.
What are the key properties of 3-thiatricyclo[5.2.2.02,6]undeca-2(6),4-dien-4-amine?
3-thiatricyclo[5.2.2.02,6]undeca-2(6),4-dien-4-amine has a molecular weight of 179.29 g/mol, XLogP of 3.09, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-thiatricyclo[5.2.2.02,6]undeca-2(6),4-dien-4-amine is sourced from PubChem (CID 118351265), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).