C17H20BrNO7 — CID 118351403
ethyl (1S,2R,3R,5R)-3-acetyl-5-(4-bromophenyl)-1,3-dihydroxy-2-nitrocyclohexane-1-carboxylate (PubChem CID 118351403) has the molecular formula C17H20BrNO7 and a molecular weight of 430.25 g/mol. Its IUPAC name is ethyl (1S,2R,3R,5R)-3-acetyl-5-(4-bromophenyl)-1,3-dihydroxy-2-nitrocyclohexane-1-carboxylate.
| Compound Name | ethyl (1S,2R,3R,5R)-3-acetyl-5-(4-bromophenyl)-1,3-dihydroxy-2-nitrocyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 118351403 |
| Molecular Formula | C17H20BrNO7 |
| Molecular Weight | 430.25 g/mol |
| Exact Mass | 429.04 |
| IUPAC Name | ethyl (1S,2R,3R,5R)-3-acetyl-5-(4-bromophenyl)-1,3-dihydroxy-2-nitrocyclohexane-1-carboxylate |
| SMILES | CCOC(=O)[C@]1(O)C[C@H](c2ccc(Br)cc2)C[C@](O)(C(C)=O)[C@H]1[N+](=O)[O-] |
| InChI | InChI=1S/C17H20BrNO7/c1-3-26-15(21)17(23)9-12(11-4-6-13(18)7-5-11)8-16(22,10(2)20)14(17)19(24)25/h4-7,12,14,22-23H,3,8-9H2,1-2H3/t12-,14-,16+,17+/m1/s1 |
| InChIKey | RZYDWPQHGYAMOI-IRWJRLHMSA-N |
| XLogP | 1.59 |
| TPSA | 126.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.25 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|