C16H18BrNO6 — CID 118351406
1-[(1R,3S)-3-acetyl-5-(4-bromophenyl)-1,3-dihydroxy-2-nitrocyclohexyl]ethanone (PubChem CID 118351406) has the molecular formula C16H18BrNO6 and a molecular weight of 400.23 g/mol. Its IUPAC name is 1-[(1R,3S)-3-acetyl-5-(4-bromophenyl)-1,3-dihydroxy-2-nitrocyclohexyl]ethanone.
| Compound Name | 1-[(1R,3S)-3-acetyl-5-(4-bromophenyl)-1,3-dihydroxy-2-nitrocyclohexyl]ethanone |
|---|---|
| PubChem CID | 118351406 |
| Molecular Formula | C16H18BrNO6 |
| Molecular Weight | 400.23 g/mol |
| Exact Mass | 399.03 |
| IUPAC Name | 1-[(1R,3S)-3-acetyl-5-(4-bromophenyl)-1,3-dihydroxy-2-nitrocyclohexyl]ethanone |
| SMILES | CC(=O)[C@]1(O)CC(c2ccc(Br)cc2)C[C@](O)(C(C)=O)C1[N+](=O)[O-] |
| InChI | InChI=1S/C16H18BrNO6/c1-9(19)15(21)7-12(11-3-5-13(17)6-4-11)8-16(22,10(2)20)14(15)18(23)24/h3-6,12,14,21-22H,7-8H2,1-2H3/t12?,14?,15-,16+ |
| InChIKey | MMTLAWJKGOGZRL-DVMLXDCBSA-N |
| XLogP | 1.61 |
| TPSA | 117.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.23 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|