C18H20F3NO7 — CID 118351411
ethyl (1S,2R,3R,5R)-3-acetyl-1,3-dihydroxy-2-nitro-5-[4-(trifluoromethyl)phenyl]cyclohexane-1-carboxylate (PubChem CID 118351411) has the molecular formula C18H20F3NO7 and a molecular weight of 419.35 g/mol. Its IUPAC name is ethyl (1S,2R,3R,5R)-3-acetyl-1,3-dihydroxy-2-nitro-5-[4-(trifluoromethyl)phenyl]cyclohexane-1-carboxylate.
| Compound Name | ethyl (1S,2R,3R,5R)-3-acetyl-1,3-dihydroxy-2-nitro-5-[4-(trifluoromethyl)phenyl]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 118351411 |
| Molecular Formula | C18H20F3NO7 |
| Molecular Weight | 419.35 g/mol |
| Exact Mass | 419.12 |
| IUPAC Name | ethyl (1S,2R,3R,5R)-3-acetyl-1,3-dihydroxy-2-nitro-5-[4-(trifluoromethyl)phenyl]cyclohexane-1-carboxylate |
| SMILES | CCOC(=O)[C@]1(O)C[C@H](c2ccc(C(F)(F)F)cc2)C[C@](O)(C(C)=O)[C@H]1[N+](=O)[O-] |
| InChI | InChI=1S/C18H20F3NO7/c1-3-29-15(24)17(26)9-12(8-16(25,10(2)23)14(17)22(27)28)11-4-6-13(7-5-11)18(19,20)21/h4-7,12,14,25-26H,3,8-9H2,1-2H3/t12-,14-,16+,17+/m1/s1 |
| InChIKey | YDSRJLUTBVCYQD-IRWJRLHMSA-N |
| XLogP | 1.84 |
| TPSA | 126.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.35 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|