C20H35N3O4 — CID 118351675
1-(4-methylheptyl)-2,4-bis[3-(oxiran-2-yl)propyl]-1,2,4-triazolidine-3,5-dione (PubChem CID 118351675) has the molecular formula C20H35N3O4 and a molecular weight of 381.52 g/mol. Its IUPAC name is 1-(4-methylheptyl)-2,4-bis[3-(oxiran-2-yl)propyl]-1,2,4-triazolidine-3,5-dione.
| Compound Name | 1-(4-methylheptyl)-2,4-bis[3-(oxiran-2-yl)propyl]-1,2,4-triazolidine-3,5-dione |
|---|---|
| PubChem CID | 118351675 |
| Molecular Formula | C20H35N3O4 |
| Molecular Weight | 381.52 g/mol |
| Exact Mass | 381.26 |
| IUPAC Name | 1-(4-methylheptyl)-2,4-bis[3-(oxiran-2-yl)propyl]-1,2,4-triazolidine-3,5-dione |
| SMILES | CCCC(C)CCCn1c(=O)n(CCCC2CO2)c(=O)n1CCCC1CO1 |
| InChI | InChI=1S/C20H35N3O4/c1-3-7-16(2)8-4-12-22-19(24)21(11-5-9-17-14-26-17)20(25)23(22)13-6-10-18-15-27-18/h16-18H,3-15H2,1-2H3 |
| InChIKey | HIVZVKZCUPIDLP-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 73.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.52 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|