About 2-[(4-fluoropiperidin-4-yl)methyl]-6-hydroxy-2,3-dihydroinden-1-one
2-[(4-fluoropiperidin-4-yl)methyl]-6-hydroxy-2,3-dihydroinden-1-one (PubChem CID 118351703) has the molecular formula C15H18FNO2
and a molecular weight of 263.31 g/mol. Its IUPAC name is 2-[(4-fluoropiperidin-4-yl)methyl]-6-hydroxy-2,3-dihydroinden-1-one.
Molecular Properties
| Compound Name | 2-[(4-fluoropiperidin-4-yl)methyl]-6-hydroxy-2,3-dihydroinden-1-one |
| PubChem CID | 118351703 |
| Molecular Formula | C15H18FNO2 |
| Molecular Weight | 263.31 g/mol |
| Exact Mass | 263.13 |
| IUPAC Name | 2-[(4-fluoropiperidin-4-yl)methyl]-6-hydroxy-2,3-dihydroinden-1-one |
| SMILES | O=C1c2cc(O)ccc2CC1CC1(F)CCNCC1 |
| InChI | InChI=1S/C15H18FNO2/c16-15(3-5-17-6-4-15)9-11-7-10-1-2-12(18)8-13(10)14(11)19/h1-2,8,11,17-18H,3-7,9H2 |
| InChIKey | AXDQDBJHAKENND-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.31 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[(4-fluoropiperidin-4-yl)methyl]-6-hydroxy-2,3-dihydroinden-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(4-fluoropiperidin-4-yl)methyl]-6-hydroxy-2,3-dihydroinden-1-one?
The IUPAC name of 2-[(4-fluoropiperidin-4-yl)methyl]-6-hydroxy-2,3-dihydroinden-1-one (CID 118351703) is 2-[(4-fluoropiperidin-4-yl)methyl]-6-hydroxy-2,3-dihydroinden-1-one.
What is the SMILES notation for 2-[(4-fluoropiperidin-4-yl)methyl]-6-hydroxy-2,3-dihydroinden-1-one?
The canonical SMILES for 2-[(4-fluoropiperidin-4-yl)methyl]-6-hydroxy-2,3-dihydroinden-1-one is O=C1c2cc(O)ccc2CC1CC1(F)CCNCC1.
What is the InChIKey of 2-[(4-fluoropiperidin-4-yl)methyl]-6-hydroxy-2,3-dihydroinden-1-one?
The InChIKey is AXDQDBJHAKENND-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18FNO2/c16-15(3-5-17-6-4-15)9-11-7-10-1-2-12(18)8-13(10)14(11)19/h1-2,8,11,17-18H,3-7,9H2.
What are the key properties of 2-[(4-fluoropiperidin-4-yl)methyl]-6-hydroxy-2,3-dihydroinden-1-one?
2-[(4-fluoropiperidin-4-yl)methyl]-6-hydroxy-2,3-dihydroinden-1-one has a molecular weight of 263.31 g/mol, XLogP of 2.23, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(4-fluoropiperidin-4-yl)methyl]-6-hydroxy-2,3-dihydroinden-1-one is sourced from PubChem (CID 118351703), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).