C26H29N7O4 — CID 118352135
N,N-diethyl-3-methoxy-4-[[4-[[3-(prop-2-enoylamino)phenyl]carbamoylamino]pyrimidin-2-yl]amino]benzamide (PubChem CID 118352135) has the molecular formula C26H29N7O4 and a molecular weight of 503.56 g/mol. Its IUPAC name is N,N-diethyl-3-methoxy-4-[[4-[[3-(prop-2-enoylamino)phenyl]carbamoylamino]pyrimidin-2-yl]amino]benzamide.
| Compound Name | N,N-diethyl-3-methoxy-4-[[4-[[3-(prop-2-enoylamino)phenyl]carbamoylamino]pyrimidin-2-yl]amino]benzamide |
|---|---|
| PubChem CID | 118352135 |
| Molecular Formula | C26H29N7O4 |
| Molecular Weight | 503.56 g/mol |
| Exact Mass | 503.23 |
| IUPAC Name | N,N-diethyl-3-methoxy-4-[[4-[[3-(prop-2-enoylamino)phenyl]carbamoylamino]pyrimidin-2-yl]amino]benzamide |
| SMILES | C=CC(=O)Nc1cccc(NC(=O)Nc2ccnc(Nc3ccc(C(=O)N(CC)CC)cc3OC)n2)c1 |
| InChI | InChI=1S/C26H29N7O4/c1-5-23(34)28-18-9-8-10-19(16-18)29-26(36)32-22-13-14-27-25(31-22)30-20-12-11-17(15-21(20)37-4)24(35)33(6-2)7-3/h5,8-16H,1,6-7H2,2-4H3,(H,28,34)(H3,27,29,30,31,32,36) |
| InChIKey | UXXAXUKFKIABIY-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 137.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.56 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|