C30H38N8O3 — CID 118352197
N-[3-[[2-[4-[4-(diethylamino)piperidin-1-yl]-2-methoxyanilino]pyrimidin-4-yl]carbamoylamino]phenyl]prop-2-enamide (PubChem CID 118352197) has the molecular formula C30H38N8O3 and a molecular weight of 558.69 g/mol. Its IUPAC name is N-[3-[[2-[4-[4-(diethylamino)piperidin-1-yl]-2-methoxyanilino]pyrimidin-4-yl]carbamoylamino]phenyl]prop-2-enamide.
| Compound Name | N-[3-[[2-[4-[4-(diethylamino)piperidin-1-yl]-2-methoxyanilino]pyrimidin-4-yl]carbamoylamino]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 118352197 |
| Molecular Formula | C30H38N8O3 |
| Molecular Weight | 558.69 g/mol |
| Exact Mass | 558.31 |
| IUPAC Name | N-[3-[[2-[4-[4-(diethylamino)piperidin-1-yl]-2-methoxyanilino]pyrimidin-4-yl]carbamoylamino]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cccc(NC(=O)Nc2ccnc(Nc3ccc(N4CCC(N(CC)CC)CC4)cc3OC)n2)c1 |
| InChI | InChI=1S/C30H38N8O3/c1-5-28(39)32-21-9-8-10-22(19-21)33-30(40)36-27-13-16-31-29(35-27)34-25-12-11-24(20-26(25)41-4)38-17-14-23(15-18-38)37(6-2)7-3/h5,8-13,16,19-20,23H,1,6-7,14-15,17-18H2,2-4H3,(H,32,39)(H3,31,33,34,35,36,40) |
| InChIKey | MMIVMSNIAOAVSX-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 123.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.69 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|