C11H8ClN3O2S — CID 118352353
2-chloro-5,11-dihydropyrido[3,4-c][1,2,5]benzothiadiazepine 6,6-dioxide (PubChem CID 118352353) has the molecular formula C11H8ClN3O2S and a molecular weight of 281.72 g/mol. Its IUPAC name is 2-chloro-5,11-dihydropyrido[3,4-c][1,2,5]benzothiadiazepine 6,6-dioxide.
| Compound Name | 2-chloro-5,11-dihydropyrido[3,4-c][1,2,5]benzothiadiazepine 6,6-dioxide |
|---|---|
| PubChem CID | 118352353 |
| Molecular Formula | C11H8ClN3O2S |
| Molecular Weight | 281.72 g/mol |
| Exact Mass | 281.00 |
| IUPAC Name | 2-chloro-5,11-dihydropyrido[3,4-c][1,2,5]benzothiadiazepine 6,6-dioxide |
| SMILES | O=S1(=O)Nc2cnc(Cl)cc2Nc2ccccc21 |
| InChI | InChI=1S/C11H8ClN3O2S/c12-11-5-8-9(6-13-11)15-18(16,17)10-4-2-1-3-7(10)14-8/h1-6,14-15H |
| InChIKey | CWSVTEBVRASEJY-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.72 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|