About 3-bromo-4-(trifluoromethyl)-1,2-dihydropyridin-6-amine
3-bromo-4-(trifluoromethyl)-1,2-dihydropyridin-6-amine (PubChem CID 118352470) has the molecular formula C6H6BrF3N2
and a molecular weight of 243.03 g/mol. Its IUPAC name is 3-bromo-4-(trifluoromethyl)-1,2-dihydropyridin-6-amine.
Molecular Properties
| Compound Name | 3-bromo-4-(trifluoromethyl)-1,2-dihydropyridin-6-amine |
| PubChem CID | 118352470 |
| Molecular Formula | C6H6BrF3N2 |
| Molecular Weight | 243.03 g/mol |
| Exact Mass | 241.97 |
| IUPAC Name | 3-bromo-4-(trifluoromethyl)-1,2-dihydropyridin-6-amine |
| SMILES | NC1=CC(C(F)(F)F)=C(Br)CN1 |
| InChI | InChI=1S/C6H6BrF3N2/c7-4-2-12-5(11)1-3(4)6(8,9)10/h1,12H,2,11H2 |
| InChIKey | DGUFNGRNDIZYHO-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.03 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-bromo-4-(trifluoromethyl)-1,2-dihydropyridin-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-4-(trifluoromethyl)-1,2-dihydropyridin-6-amine?
The IUPAC name of 3-bromo-4-(trifluoromethyl)-1,2-dihydropyridin-6-amine (CID 118352470) is 3-bromo-4-(trifluoromethyl)-1,2-dihydropyridin-6-amine.
What is the SMILES notation for 3-bromo-4-(trifluoromethyl)-1,2-dihydropyridin-6-amine?
The canonical SMILES for 3-bromo-4-(trifluoromethyl)-1,2-dihydropyridin-6-amine is NC1=CC(C(F)(F)F)=C(Br)CN1.
What is the InChIKey of 3-bromo-4-(trifluoromethyl)-1,2-dihydropyridin-6-amine?
The InChIKey is DGUFNGRNDIZYHO-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6BrF3N2/c7-4-2-12-5(11)1-3(4)6(8,9)10/h1,12H,2,11H2.
What are the key properties of 3-bromo-4-(trifluoromethyl)-1,2-dihydropyridin-6-amine?
3-bromo-4-(trifluoromethyl)-1,2-dihydropyridin-6-amine has a molecular weight of 243.03 g/mol, XLogP of 1.60, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-4-(trifluoromethyl)-1,2-dihydropyridin-6-amine is sourced from PubChem (CID 118352470), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).