About 3,5-ditert-butyl-N,N-dicyclohexyl-4-hydroxybenzamide
3,5-ditert-butyl-N,N-dicyclohexyl-4-hydroxybenzamide (PubChem CID 11835262) has the molecular formula C27H43NO2
and a molecular weight of 413.65 g/mol. Its IUPAC name is 3,5-ditert-butyl-N,N-dicyclohexyl-4-hydroxybenzamide.
Molecular Properties
| Compound Name | 3,5-ditert-butyl-N,N-dicyclohexyl-4-hydroxybenzamide |
| PubChem CID | 11835262 |
| Molecular Formula | C27H43NO2 |
| Molecular Weight | 413.65 g/mol |
| Exact Mass | 413.33 |
| IUPAC Name | 3,5-ditert-butyl-N,N-dicyclohexyl-4-hydroxybenzamide |
| SMILES | CC(C)(C)c1cc(C(=O)N(C2CCCCC2)C2CCCCC2)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C27H43NO2/c1-26(2,3)22-17-19(18-23(24(22)29)27(4,5)6)25(30)28(20-13-9-7-10-14-20)21-15-11-8-12-16-21/h17-18,20-21,29H,7-16H2,1-6H3 |
| InChIKey | QSLCKHFBIOLNSN-UHFFFAOYSA-N |
| XLogP | 7.09 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 413.65 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3,5-ditert-butyl-N,N-dicyclohexyl-4-hydroxybenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-ditert-butyl-N,N-dicyclohexyl-4-hydroxybenzamide?
The IUPAC name of 3,5-ditert-butyl-N,N-dicyclohexyl-4-hydroxybenzamide (CID 11835262) is 3,5-ditert-butyl-N,N-dicyclohexyl-4-hydroxybenzamide.
What is the SMILES notation for 3,5-ditert-butyl-N,N-dicyclohexyl-4-hydroxybenzamide?
The canonical SMILES for 3,5-ditert-butyl-N,N-dicyclohexyl-4-hydroxybenzamide is CC(C)(C)c1cc(C(=O)N(C2CCCCC2)C2CCCCC2)cc(C(C)(C)C)c1O.
What is the InChIKey of 3,5-ditert-butyl-N,N-dicyclohexyl-4-hydroxybenzamide?
The InChIKey is QSLCKHFBIOLNSN-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H43NO2/c1-26(2,3)22-17-19(18-23(24(22)29)27(4,5)6)25(30)28(20-13-9-7-10-14-20)21-15-11-8-12-16-21/h17-18,20-21,29H,7-16H2,1-6H3.
What are the key properties of 3,5-ditert-butyl-N,N-dicyclohexyl-4-hydroxybenzamide?
3,5-ditert-butyl-N,N-dicyclohexyl-4-hydroxybenzamide has a molecular weight of 413.65 g/mol, XLogP of 7.09, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-ditert-butyl-N,N-dicyclohexyl-4-hydroxybenzamide is sourced from PubChem (CID 11835262), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).