C17H18O — CID 118352720
(6-phenyl-1,2,3,4-tetrahydronaphthalen-2-yl)methanol (PubChem CID 118352720) has the molecular formula C17H18O and a molecular weight of 238.33 g/mol. Its IUPAC name is (6-phenyl-1,2,3,4-tetrahydronaphthalen-2-yl)methanol.
| Compound Name | (6-phenyl-1,2,3,4-tetrahydronaphthalen-2-yl)methanol |
|---|---|
| PubChem CID | 118352720 |
| Molecular Formula | C17H18O |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.14 |
| IUPAC Name | (6-phenyl-1,2,3,4-tetrahydronaphthalen-2-yl)methanol |
| SMILES | OCC1CCc2cc(-c3ccccc3)ccc2C1 |
| InChI | InChI=1S/C17H18O/c18-12-13-6-7-17-11-16(9-8-15(17)10-13)14-4-2-1-3-5-14/h1-5,8-9,11,13,18H,6-7,10,12H2 |
| InChIKey | IGFDWAUVTXOSDI-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |