C11H10BrFO2 — CID 118353727
4-(bromomethyl)-5-cyclopropyl-2-fluorobenzoic acid (PubChem CID 118353727) has the molecular formula C11H10BrFO2 and a molecular weight of 273.10 g/mol. Its IUPAC name is 4-(bromomethyl)-5-cyclopropyl-2-fluorobenzoic acid.
| Compound Name | 4-(bromomethyl)-5-cyclopropyl-2-fluorobenzoic acid |
|---|---|
| PubChem CID | 118353727 |
| Molecular Formula | C11H10BrFO2 |
| Molecular Weight | 273.10 g/mol |
| Exact Mass | 271.98 |
| IUPAC Name | 4-(bromomethyl)-5-cyclopropyl-2-fluorobenzoic acid |
| SMILES | O=C(O)c1cc(C2CC2)c(CBr)cc1F |
| InChI | InChI=1S/C11H10BrFO2/c12-5-7-3-10(13)9(11(14)15)4-8(7)6-1-2-6/h3-4,6H,1-2,5H2,(H,14,15) |
| InChIKey | YUORPCGJPSSBJP-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.10 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|