C12H19N3O3 — CID 118353957
trans-(1S,2S)-2-[(8aS)-3-oxo-1,5,6,7,8,8a-hexahydroimidazo[1,5-a]pyrazin-2-yl]cyclopentane-1-carboxylic acid (PubChem CID 118353957) has the molecular formula C12H19N3O3 and a molecular weight of 253.30 g/mol. Its IUPAC name is trans-(1S,2S)-2-[(8aS)-3-oxo-1,5,6,7,8,8a-hexahydroimidazo[1,5-a]pyrazin-2-yl]cyclopentane-1-carboxylic acid.
| Compound Name | trans-(1S,2S)-2-[(8aS)-3-oxo-1,5,6,7,8,8a-hexahydroimidazo[1,5-a]pyrazin-2-yl]cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 118353957 |
| Molecular Formula | C12H19N3O3 |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.14 |
| IUPAC Name | trans-(1S,2S)-2-[(8aS)-3-oxo-1,5,6,7,8,8a-hexahydroimidazo[1,5-a]pyrazin-2-yl]cyclopentane-1-carboxylic acid |
| SMILES | O=C(O)[C@H]1CCC[C@@H]1N1C[C@@H]2CNCCN2C1=O |
| InChI | InChI=1S/C12H19N3O3/c16-11(17)9-2-1-3-10(9)15-7-8-6-13-4-5-14(8)12(15)18/h8-10,13H,1-7H2,(H,16,17)/t8-,9-,10-/m0/s1 |
| InChIKey | NPLCCFXTWOIYKF-GUBZILKMSA-N |
| XLogP | -0.05 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |