C22H26Cl2F3N5O — CID 118354320
3-[1-(2,3-dichloro-4-pyrazin-2-ylphenyl)-2,2,2-trifluoroethyl]-1-methyl-1-(1,3,3-trimethylpiperidin-4-yl)urea (PubChem CID 118354320) has the molecular formula C22H26Cl2F3N5O and a molecular weight of 504.38 g/mol. Its IUPAC name is 3-[1-(2,3-dichloro-4-pyrazin-2-ylphenyl)-2,2,2-trifluoroethyl]-1-methyl-1-(1,3,3-trimethylpiperidin-4-yl)urea.
| Compound Name | 3-[1-(2,3-dichloro-4-pyrazin-2-ylphenyl)-2,2,2-trifluoroethyl]-1-methyl-1-(1,3,3-trimethylpiperidin-4-yl)urea |
|---|---|
| PubChem CID | 118354320 |
| Molecular Formula | C22H26Cl2F3N5O |
| Molecular Weight | 504.38 g/mol |
| Exact Mass | 503.15 |
| IUPAC Name | 3-[1-(2,3-dichloro-4-pyrazin-2-ylphenyl)-2,2,2-trifluoroethyl]-1-methyl-1-(1,3,3-trimethylpiperidin-4-yl)urea |
| SMILES | CN1CCC(N(C)C(=O)NC(c2ccc(-c3cnccn3)c(Cl)c2Cl)C(F)(F)F)C(C)(C)C1 |
| InChI | InChI=1S/C22H26Cl2F3N5O/c1-21(2)12-31(3)10-7-16(21)32(4)20(33)30-19(22(25,26)27)14-6-5-13(17(23)18(14)24)15-11-28-8-9-29-15/h5-6,8-9,11,16,19H,7,10,12H2,1-4H3,(H,30,33) |
| InChIKey | ITJRUTXTYVZOPZ-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.38 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |