About 2-[4-(1,3-benzothiazol-2-yl)-1H-pyrazol-5-yl]-5-[(4-nitrophenyl)methoxy]phenol
2-[4-(1,3-benzothiazol-2-yl)-1H-pyrazol-5-yl]-5-[(4-nitrophenyl)methoxy]phenol (PubChem CID 1183548) has the molecular formula C23H16N4O4S
and a molecular weight of 444.47 g/mol. Its IUPAC name is 2-[4-(1,3-benzothiazol-2-yl)-1H-pyrazol-5-yl]-5-[(4-nitrophenyl)methoxy]phenol.
Molecular Properties
| Compound Name | 2-[4-(1,3-benzothiazol-2-yl)-1H-pyrazol-5-yl]-5-[(4-nitrophenyl)methoxy]phenol |
| PubChem CID | 1183548 |
| Molecular Formula | C23H16N4O4S |
| Molecular Weight | 444.47 g/mol |
| Exact Mass | 444.09 |
| IUPAC Name | 2-[4-(1,3-benzothiazol-2-yl)-1H-pyrazol-5-yl]-5-[(4-nitrophenyl)methoxy]phenol |
| SMILES | O=[N+]([O-])c1ccc(COc2ccc(-c3[nH]ncc3-c3nc4ccccc4s3)c(O)c2)cc1 |
| InChI | InChI=1S/C23H16N4O4S/c28-20-11-16(31-13-14-5-7-15(8-6-14)27(29)30)9-10-17(20)22-18(12-24-26-22)23-25-19-3-1-2-4-21(19)32-23/h1-12,28H,13H2,(H,24,26) |
| InChIKey | VQEFUALYCVSXFE-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 114.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 444.47 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[4-(1,3-benzothiazol-2-yl)-1H-pyrazol-5-yl]-5-[(4-nitrophenyl)methoxy]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(1,3-benzothiazol-2-yl)-1H-pyrazol-5-yl]-5-[(4-nitrophenyl)methoxy]phenol?
The IUPAC name of 2-[4-(1,3-benzothiazol-2-yl)-1H-pyrazol-5-yl]-5-[(4-nitrophenyl)methoxy]phenol (CID 1183548) is 2-[4-(1,3-benzothiazol-2-yl)-1H-pyrazol-5-yl]-5-[(4-nitrophenyl)methoxy]phenol.
What is the SMILES notation for 2-[4-(1,3-benzothiazol-2-yl)-1H-pyrazol-5-yl]-5-[(4-nitrophenyl)methoxy]phenol?
The canonical SMILES for 2-[4-(1,3-benzothiazol-2-yl)-1H-pyrazol-5-yl]-5-[(4-nitrophenyl)methoxy]phenol is O=[N+]([O-])c1ccc(COc2ccc(-c3[nH]ncc3-c3nc4ccccc4s3)c(O)c2)cc1.
What is the InChIKey of 2-[4-(1,3-benzothiazol-2-yl)-1H-pyrazol-5-yl]-5-[(4-nitrophenyl)methoxy]phenol?
The InChIKey is VQEFUALYCVSXFE-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H16N4O4S/c28-20-11-16(31-13-14-5-7-15(8-6-14)27(29)30)9-10-17(20)22-18(12-24-26-22)23-25-19-3-1-2-4-21(19)32-23/h1-12,28H,13H2,(H,24,26).
What are the key properties of 2-[4-(1,3-benzothiazol-2-yl)-1H-pyrazol-5-yl]-5-[(4-nitrophenyl)methoxy]phenol?
2-[4-(1,3-benzothiazol-2-yl)-1H-pyrazol-5-yl]-5-[(4-nitrophenyl)methoxy]phenol has a molecular weight of 444.47 g/mol, XLogP of 5.55, 6 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(1,3-benzothiazol-2-yl)-1H-pyrazol-5-yl]-5-[(4-nitrophenyl)methoxy]phenol is sourced from PubChem (CID 1183548), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).