About 4-bromo-1-iodo-2-methoxybenzene;6,10-dioxaspiro[4.5]decane-7,9-dione
4-bromo-1-iodo-2-methoxybenzene;6,10-dioxaspiro[4.5]decane-7,9-dione (PubChem CID 118355455) has the molecular formula C15H16BrIO5
and a molecular weight of 483.10 g/mol. Its IUPAC name is 4-bromo-1-iodo-2-methoxybenzene;6,10-dioxaspiro[4.5]decane-7,9-dione.
Molecular Properties
| Compound Name | 4-bromo-1-iodo-2-methoxybenzene;6,10-dioxaspiro[4.5]decane-7,9-dione |
| PubChem CID | 118355455 |
| Molecular Formula | C15H16BrIO5 |
| Molecular Weight | 483.10 g/mol |
| Exact Mass | 481.92 |
| IUPAC Name | 4-bromo-1-iodo-2-methoxybenzene;6,10-dioxaspiro[4.5]decane-7,9-dione |
| SMILES | COc1cc(Br)ccc1I.O=C1CC(=O)OC2(CCCC2)O1 |
| InChI | InChI=1S/C8H10O4.C7H6BrIO/c9-6-5-7(10)12-8(11-6)3-1-2-4-8;1-10-7-4-5(8)2-3-6(7)9/h1-5H2;2-4H,1H3 |
| InChIKey | LLDRQHJNMSUITD-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 483.10 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 4-bromo-1-iodo-2-methoxybenzene;6,10-dioxaspiro[4.5]decane-7,9-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-1-iodo-2-methoxybenzene;6,10-dioxaspiro[4.5]decane-7,9-dione?
The IUPAC name of 4-bromo-1-iodo-2-methoxybenzene;6,10-dioxaspiro[4.5]decane-7,9-dione (CID 118355455) is 4-bromo-1-iodo-2-methoxybenzene;6,10-dioxaspiro[4.5]decane-7,9-dione.
What is the SMILES notation for 4-bromo-1-iodo-2-methoxybenzene;6,10-dioxaspiro[4.5]decane-7,9-dione?
The canonical SMILES for 4-bromo-1-iodo-2-methoxybenzene;6,10-dioxaspiro[4.5]decane-7,9-dione is COc1cc(Br)ccc1I.O=C1CC(=O)OC2(CCCC2)O1.
What is the InChIKey of 4-bromo-1-iodo-2-methoxybenzene;6,10-dioxaspiro[4.5]decane-7,9-dione?
The InChIKey is LLDRQHJNMSUITD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10O4.C7H6BrIO/c9-6-5-7(10)12-8(11-6)3-1-2-4-8;1-10-7-4-5(8)2-3-6(7)9/h1-5H2;2-4H,1H3.
What are the key properties of 4-bromo-1-iodo-2-methoxybenzene;6,10-dioxaspiro[4.5]decane-7,9-dione?
4-bromo-1-iodo-2-methoxybenzene;6,10-dioxaspiro[4.5]decane-7,9-dione has a molecular weight of 483.10 g/mol, XLogP of 3.81, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-1-iodo-2-methoxybenzene;6,10-dioxaspiro[4.5]decane-7,9-dione is sourced from PubChem (CID 118355455), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).