C45H33N5O2 — CID 11835673
3-(4-nitrophenyl)-1,2',3',3',4-pentakis-phenylspiro[1,2,4-triazole-5,1'-isoindole] (PubChem CID 11835673) has the molecular formula C45H33N5O2 and a molecular weight of 675.79 g/mol. Its IUPAC name is 3-(4-nitrophenyl)-1,2',3',3',4-pentakis-phenylspiro[1,2,4-triazole-5,1'-isoindole].
| Compound Name | 3-(4-nitrophenyl)-1,2',3',3',4-pentakis-phenylspiro[1,2,4-triazole-5,1'-isoindole] |
|---|---|
| PubChem CID | 11835673 |
| Molecular Formula | C45H33N5O2 |
| Molecular Weight | 675.79 g/mol |
| Exact Mass | 675.26 |
| IUPAC Name | 3-(4-nitrophenyl)-1,2',3',3',4-pentakis-phenylspiro[1,2,4-triazole-5,1'-isoindole] |
| SMILES | O=[N+]([O-])c1ccc(C2=NN(c3ccccc3)C3(c4ccccc4C(c4ccccc4)(c4ccccc4)N3c3ccccc3)N2c2ccccc2)cc1 |
| InChI | InChI=1S/C45H33N5O2/c51-50(52)40-32-30-34(31-33-40)43-46-49(39-26-14-5-15-27-39)45(47(43)37-22-10-3-11-23-37)42-29-17-16-28-41(42)44(35-18-6-1-7-19-35,36-20-8-2-9-21-36)48(45)38-24-12-4-13-25-38/h1-33H |
| InChIKey | MHMJSZPKPDAMKI-UHFFFAOYSA-N |
| XLogP | 9.91 |
| TPSA | 65.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.79 |
| LogP ≤ 5 | 9.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|