C32H35N7O2 — CID 118356761
4-[8-amino-3-[2-[(E)-4-(dimethylamino)but-2-enoyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-yl]imidazo[1,5-a]pyrazin-1-yl]-N-phenylbenzamide (PubChem CID 118356761) has the molecular formula C32H35N7O2 and a molecular weight of 549.68 g/mol. Its IUPAC name is 4-[8-amino-3-[2-[(E)-4-(dimethylamino)but-2-enoyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-yl]imidazo[1,5-a]pyrazin-1-yl]-N-phenylbenzamide.
| Compound Name | 4-[8-amino-3-[2-[(E)-4-(dimethylamino)but-2-enoyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-yl]imidazo[1,5-a]pyrazin-1-yl]-N-phenylbenzamide |
|---|---|
| PubChem CID | 118356761 |
| Molecular Formula | C32H35N7O2 |
| Molecular Weight | 549.68 g/mol |
| Exact Mass | 549.29 |
| IUPAC Name | 4-[8-amino-3-[2-[(E)-4-(dimethylamino)but-2-enoyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-yl]imidazo[1,5-a]pyrazin-1-yl]-N-phenylbenzamide |
| SMILES | CN(C)C/C=C/C(=O)N1CC2CC(c3nc(-c4ccc(C(=O)Nc5ccccc5)cc4)c4c(N)nccn34)CC2C1 |
| InChI | InChI=1S/C32H35N7O2/c1-37(2)15-6-9-27(40)38-19-24-17-23(18-25(24)20-38)31-36-28(29-30(33)34-14-16-39(29)31)21-10-12-22(13-11-21)32(41)35-26-7-4-3-5-8-26/h3-14,16,23-25H,15,17-20H2,1-2H3,(H2,33,34)(H,35,41)/b9-6+ |
| InChIKey | NXTWUWSPGDJPOC-RMKNXTFCSA-N |
| XLogP | 4.30 |
| TPSA | 108.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.68 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|