C30H19ClN2O2 — CID 118356941
11-(5-chloro-2-nitrophenyl)-14-phenyl-14-azatetracyclo[13.4.0.02,7.08,13]nonadeca-1(19),2,4,6,8(13),9,11,15,17-nonaene (PubChem CID 118356941) has the molecular formula C30H19ClN2O2 and a molecular weight of 474.95 g/mol. Its IUPAC name is 11-(5-chloro-2-nitrophenyl)-14-phenyl-14-azatetracyclo[13.4.0.02,7.08,13]nonadeca-1(19),2,4,6,8(13),9,11,15,17-nonaene.
| Compound Name | 11-(5-chloro-2-nitrophenyl)-14-phenyl-14-azatetracyclo[13.4.0.02,7.08,13]nonadeca-1(19),2,4,6,8(13),9,11,15,17-nonaene |
|---|---|
| PubChem CID | 118356941 |
| Molecular Formula | C30H19ClN2O2 |
| Molecular Weight | 474.95 g/mol |
| Exact Mass | 474.11 |
| IUPAC Name | 11-(5-chloro-2-nitrophenyl)-14-phenyl-14-azatetracyclo[13.4.0.02,7.08,13]nonadeca-1(19),2,4,6,8(13),9,11,15,17-nonaene |
| SMILES | O=[N+]([O-])c1ccc(Cl)cc1-c1ccc2c(c1)N(c1ccccc1)c1ccccc1-c1ccccc1-2 |
| InChI | InChI=1S/C30H19ClN2O2/c31-21-15-17-29(33(34)35)27(19-21)20-14-16-26-24-11-5-4-10-23(24)25-12-6-7-13-28(25)32(30(26)18-20)22-8-2-1-3-9-22/h1-19H |
| InChIKey | LLAKXFKIRNQFAB-UHFFFAOYSA-N |
| XLogP | 9.03 |
| TPSA | 46.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.95 |
| LogP ≤ 5 | 9.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|