C18H17N3O2 — CID 118357157
1,3-dibenzyl-6-methyl-1,3,5-triazine-2,4-dione (PubChem CID 118357157) has the molecular formula C18H17N3O2 and a molecular weight of 307.35 g/mol. Its IUPAC name is 1,3-dibenzyl-6-methyl-1,3,5-triazine-2,4-dione.
| Compound Name | 1,3-dibenzyl-6-methyl-1,3,5-triazine-2,4-dione |
|---|---|
| PubChem CID | 118357157 |
| Molecular Formula | C18H17N3O2 |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.13 |
| IUPAC Name | 1,3-dibenzyl-6-methyl-1,3,5-triazine-2,4-dione |
| SMILES | Cc1nc(=O)n(Cc2ccccc2)c(=O)n1Cc1ccccc1 |
| InChI | InChI=1S/C18H17N3O2/c1-14-19-17(22)21(13-16-10-6-3-7-11-16)18(23)20(14)12-15-8-4-2-5-9-15/h2-11H,12-13H2,1H3 |
| InChIKey | QZRLUGZGXFMZDZ-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 56.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |