C14H25N — CID 118357210
6-cyclohexyl-4-propan-2-yl-1,2,3,6-tetrahydropyridine (PubChem CID 118357210) has the molecular formula C14H25N and a molecular weight of 207.36 g/mol. Its IUPAC name is 6-cyclohexyl-4-propan-2-yl-1,2,3,6-tetrahydropyridine.
| Compound Name | 6-cyclohexyl-4-propan-2-yl-1,2,3,6-tetrahydropyridine |
|---|---|
| PubChem CID | 118357210 |
| Molecular Formula | C14H25N |
| Molecular Weight | 207.36 g/mol |
| Exact Mass | 207.20 |
| IUPAC Name | 6-cyclohexyl-4-propan-2-yl-1,2,3,6-tetrahydropyridine |
| SMILES | CC(C)C1=CC(C2CCCCC2)NCC1 |
| InChI | InChI=1S/C14H25N/c1-11(2)13-8-9-15-14(10-13)12-6-4-3-5-7-12/h10-12,14-15H,3-9H2,1-2H3 |
| InChIKey | GIRBCNHOFATVSA-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.36 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|