C12H21N — CID 118357409
6-cyclohexyl-4-methyl-1,2,3,6-tetrahydropyridine (PubChem CID 118357409) has the molecular formula C12H21N and a molecular weight of 179.31 g/mol. Its IUPAC name is 6-cyclohexyl-4-methyl-1,2,3,6-tetrahydropyridine.
| Compound Name | 6-cyclohexyl-4-methyl-1,2,3,6-tetrahydropyridine |
|---|---|
| PubChem CID | 118357409 |
| Molecular Formula | C12H21N |
| Molecular Weight | 179.31 g/mol |
| Exact Mass | 179.17 |
| IUPAC Name | 6-cyclohexyl-4-methyl-1,2,3,6-tetrahydropyridine |
| SMILES | CC1=CC(C2CCCCC2)NCC1 |
| InChI | InChI=1S/C12H21N/c1-10-7-8-13-12(9-10)11-5-3-2-4-6-11/h9,11-13H,2-8H2,1H3 |
| InChIKey | XHJAEGJXXDLDCW-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.31 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|