About 3-(difluoromethyl)-1-ethyl-7,7-difluoro-5,6-dihydro-4H-indazol-4-ol
3-(difluoromethyl)-1-ethyl-7,7-difluoro-5,6-dihydro-4H-indazol-4-ol (PubChem CID 118357662) has the molecular formula C10H12F4N2O
and a molecular weight of 252.21 g/mol. Its IUPAC name is 3-(difluoromethyl)-1-ethyl-7,7-difluoro-5,6-dihydro-4H-indazol-4-ol.
Molecular Properties
| Compound Name | 3-(difluoromethyl)-1-ethyl-7,7-difluoro-5,6-dihydro-4H-indazol-4-ol |
| PubChem CID | 118357662 |
| Molecular Formula | C10H12F4N2O |
| Molecular Weight | 252.21 g/mol |
| Exact Mass | 252.09 |
| IUPAC Name | 3-(difluoromethyl)-1-ethyl-7,7-difluoro-5,6-dihydro-4H-indazol-4-ol |
| SMILES | CCn1nc(C(F)F)c2c1C(F)(F)CCC2O |
| InChI | InChI=1S/C10H12F4N2O/c1-2-16-8-6(7(15-16)9(11)12)5(17)3-4-10(8,13)14/h5,9,17H,2-4H2,1H3 |
| InChIKey | VKNKBAFWAJXGHQ-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.21 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(difluoromethyl)-1-ethyl-7,7-difluoro-5,6-dihydro-4H-indazol-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(difluoromethyl)-1-ethyl-7,7-difluoro-5,6-dihydro-4H-indazol-4-ol?
The IUPAC name of 3-(difluoromethyl)-1-ethyl-7,7-difluoro-5,6-dihydro-4H-indazol-4-ol (CID 118357662) is 3-(difluoromethyl)-1-ethyl-7,7-difluoro-5,6-dihydro-4H-indazol-4-ol.
What is the SMILES notation for 3-(difluoromethyl)-1-ethyl-7,7-difluoro-5,6-dihydro-4H-indazol-4-ol?
The canonical SMILES for 3-(difluoromethyl)-1-ethyl-7,7-difluoro-5,6-dihydro-4H-indazol-4-ol is CCn1nc(C(F)F)c2c1C(F)(F)CCC2O.
What is the InChIKey of 3-(difluoromethyl)-1-ethyl-7,7-difluoro-5,6-dihydro-4H-indazol-4-ol?
The InChIKey is VKNKBAFWAJXGHQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12F4N2O/c1-2-16-8-6(7(15-16)9(11)12)5(17)3-4-10(8,13)14/h5,9,17H,2-4H2,1H3.
What are the key properties of 3-(difluoromethyl)-1-ethyl-7,7-difluoro-5,6-dihydro-4H-indazol-4-ol?
3-(difluoromethyl)-1-ethyl-7,7-difluoro-5,6-dihydro-4H-indazol-4-ol has a molecular weight of 252.21 g/mol, XLogP of 2.76, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(difluoromethyl)-1-ethyl-7,7-difluoro-5,6-dihydro-4H-indazol-4-ol is sourced from PubChem (CID 118357662), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).